The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(((6-Methylhept-5-en-1-yl)phosphoryl)bis(oxy))bis-(methylene)bis(2,2-dimethylpropanoate) ID: ALA4592130
PubChem CID: 155554209
Max Phase: Preclinical
Molecular Formula: C20H37O7P
Molecular Weight: 420.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCCCCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C
Standard InChI: InChI=1S/C20H37O7P/c1-16(2)12-10-9-11-13-28(23,26-14-24-17(21)19(3,4)5)27-15-25-18(22)20(6,7)8/h12H,9-11,13-15H2,1-8H3
Standard InChI Key: VQITZHFLYXLUAS-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 27 0 0 0 0 0 0 0 0999 V2000
12.1967 -4.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3616 -8.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7802 -8.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4915 -6.4447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3409 -8.9089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6237 -9.3154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2028 -6.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4707 -7.6768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8882 -9.3154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4915 -4.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6503 -8.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9142 -7.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4915 -8.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9142 -4.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7595 -8.9089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4707 -8.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3616 -7.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8934 -8.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6296 -7.6768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1820 -8.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0688 -8.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0523 -8.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6296 -8.4982 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
12.2028 -5.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9142 -6.4447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9142 -8.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2028 -8.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1820 -9.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20 28 1 0
20 9 1 0
7 4 2 0
7 24 1 0
27 26 1 0
19 12 1 0
16 20 1 0
26 23 1 0
21 2 2 0
23 5 1 0
2 17 1 0
24 10 1 0
3 21 1 0
23 6 2 0
13 27 1 0
22 15 1 0
24 14 1 0
24 1 1 0
2 11 1 0
16 8 2 0
12 25 1 0
13 3 1 0
5 22 1 0
23 19 1 0
25 7 1 0
15 16 1 0
20 18 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.48Molecular Weight (Monoisotopic): 420.2277AlogP: 5.44#Rotatable Bonds: 11Polar Surface Area: 88.13Molecular Species: ┄HBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.87CX LogD: 5.87Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.14Np Likeness Score: 0.71