((1R,5aS,6R,9aS)-1,5a-dimethyl-7-methylene-3-oxo-6-((E)-2-(2-oxo-2,5-dihydrofuran-3-yl)ethenyl)decahydro-1H-benzo[c]azepin-1-yl)methyl benzoate

ID: ALA4592431

PubChem CID: 155569173

Max Phase: Preclinical

Molecular Formula: C27H31NO5

Molecular Weight: 449.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1CC[C@H]2[C@@](C)(CCC(=O)N[C@@]2(C)COC(=O)c2ccccc2)[C@@H]1/C=C/C1=CCOC1=O

Standard InChI:  InChI=1S/C27H31NO5/c1-18-9-12-22-26(2,21(18)11-10-20-14-16-32-24(20)30)15-13-23(29)28-27(22,3)17-33-25(31)19-7-5-4-6-8-19/h4-8,10-11,14,21-22H,1,9,12-13,15-17H2,2-3H3,(H,28,29)/b11-10+/t21-,22+,26+,27+/m1/s1

Standard InChI Key:  LCKJDMDNIAQVMC-IYFJMWNJSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   17.3550   -6.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7772   -6.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5657   -6.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1263   -5.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8316   -5.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8316   -4.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1263   -4.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4231   -4.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4210   -5.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7792   -4.2194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9766   -5.8864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9768   -4.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6225   -5.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6315   -6.3394    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.8053   -5.1465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4169   -3.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1262   -3.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8338   -3.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8336   -2.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4911   -1.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2384   -1.0177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4211   -1.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1689   -1.7951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2690   -2.0451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5405   -4.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1722   -6.6407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5808   -7.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3980   -7.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1722   -8.0561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8037   -8.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6202   -8.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0296   -7.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6166   -6.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8015   -6.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  7  1  0
  9  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  1  0
  9  2  1  0
  8 10  1  0
  2 11  1  0
 10 12  1  0
 11 13  1  0
 12 13  1  0
  9 14  1  1
 13 15  2  0
  8 16  1  6
  7 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  2  0
 20 24  2  0
  6 25  2  0
  2  3  1  1
  2  1  1  0
  1 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4592431

    ---

Associated Targets(Human)

HK2 Tchem Hexokinase type II (81 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.55Molecular Weight (Monoisotopic): 449.2202AlogP: 4.14#Rotatable Bonds: 5
Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.74CX Basic pKa: CX LogP: 4.17CX LogD: 4.17
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: 2.05

References

1. Wang W, Wu Y, Yang K, Wu C, Tang R, Li H, Chen L..  (2019)  Synthesis of novel andrographolide beckmann rearrangement derivatives and evaluation of their HK2-related anti-inflammatory activities.,  173  [PMID:31009914] [10.1016/j.ejmech.2019.04.022]

Source