The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
trans-9,10-Bis(benzyloxy)-4-(4-methoxyphenyl)-3,4,6,7-tetrahydro-1H-pyrido[2,1-a]isoquinolin-2(11bH)-one ID: ALA4592517
PubChem CID: 155569137
Max Phase: Preclinical
Molecular Formula: C34H33NO4
Molecular Weight: 519.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@H]2CC(=O)C[C@H]3c4cc(OCc5ccccc5)c(OCc5ccccc5)cc4CCN23)cc1
Standard InChI: InChI=1S/C34H33NO4/c1-37-29-14-12-26(13-15-29)31-19-28(36)20-32-30-21-34(39-23-25-10-6-3-7-11-25)33(18-27(30)16-17-35(31)32)38-22-24-8-4-2-5-9-24/h2-15,18,21,31-32H,16-17,19-20,22-23H2,1H3/t31-,32-/m0/s1
Standard InChI Key: MGDKOUZBSPXQEI-ACHIHNKUSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
11.8257 -10.6232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8258 -9.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1113 -9.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1112 -8.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3968 -8.9732 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.3968 -8.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6823 -8.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9678 -8.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2533 -8.5607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5388 -8.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8243 -8.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8243 -9.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1098 -9.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3953 -9.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3953 -8.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1098 -8.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9678 -7.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2533 -6.9106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2533 -6.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5388 -5.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8243 -6.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1098 -5.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1098 -4.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8243 -4.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5388 -4.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6823 -6.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3968 -7.3232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1113 -6.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8257 -7.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8257 -8.1481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5403 -8.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5403 -9.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2509 -8.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9580 -8.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6682 -8.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6686 -7.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9529 -6.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2457 -7.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3825 -6.9195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3815 -6.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 6
4 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
11 16 1 0
8 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
20 25 1 0
17 26 1 0
26 27 2 0
6 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
4 30 1 0
30 31 1 0
31 32 1 0
2 32 1 0
31 33 1 6
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
36 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.64Molecular Weight (Monoisotopic): 519.2410AlogP: 6.86#Rotatable Bonds: 8Polar Surface Area: 48.00Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.39CX LogP: 6.76CX LogD: 6.72Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: 0.18
References 1. Zheng H, Dong Y, Li L, Sun B, Liu L, Yuan H, Lou H.. (2016) Novel Benzo[a]quinolizidine Analogs Induce Cancer Cell Death through Paraptosis and Apoptosis., 59 (10): [PMID:27077446 ] [10.1021/acs.jmedchem.6b00484 ]