The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4'-fluoro-N-(4-(4-morpholino-1-(phenylthio)butan-2-ylamino)-3-nitrophenylsulfonyl)biphenyl-4-carboxamide ID: ALA4592905
PubChem CID: 155569283
Max Phase: Preclinical
Molecular Formula: C33H33FN4O6S2
Molecular Weight: 664.78
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NS(=O)(=O)c1ccc(N[C@H](CCN2CCOCC2)CSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(-c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C33H33FN4O6S2/c34-27-12-10-25(11-13-27)24-6-8-26(9-7-24)33(39)36-46(42,43)30-14-15-31(32(22-30)38(40)41)35-28(16-17-37-18-20-44-21-19-37)23-45-29-4-2-1-3-5-29/h1-15,22,28,35H,16-21,23H2,(H,36,39)/t28-/m1/s1
Standard InChI Key: MYJSNJIVDDYHMU-MUUNZHRXSA-N
Molfile:
RDKit 2D
46 50 0 0 0 0 0 0 0 0999 V2000
32.7908 -17.9782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3864 -17.2725 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.9774 -17.9756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2718 -18.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2707 -19.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9787 -19.7350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6884 -19.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6855 -18.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9769 -18.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9804 -20.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2709 -20.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2704 -21.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9785 -22.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6887 -21.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6858 -20.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9794 -23.0010 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.9745 -17.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6810 -16.8697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2656 -16.8739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0964 -16.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8034 -17.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5094 -16.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5074 -16.0461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7935 -15.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0904 -16.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2201 -17.2732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.9267 -16.8629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2221 -18.0904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2133 -15.6344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2098 -14.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9157 -14.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5003 -14.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4968 -13.5945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7873 -13.1890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7878 -12.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0824 -11.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3741 -12.3718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3756 -13.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0855 -13.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6252 -14.8112 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.3311 -14.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0367 -14.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7422 -14.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7391 -13.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0247 -13.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3221 -13.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
6 10 1 0
13 16 1 0
9 17 1 0
17 18 1 0
17 19 2 0
18 2 1 0
2 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
26 27 2 0
26 28 1 0
22 26 1 0
23 29 1 0
29 30 1 0
30 31 1 0
30 32 1 6
32 33 1 0
33 34 1 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
31 40 1 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
M CHG 2 26 1 28 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 664.78Molecular Weight (Monoisotopic): 664.1826AlogP: 5.81#Rotatable Bonds: 13Polar Surface Area: 130.88Molecular Species: ACIDHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.27CX Basic pKa: 6.76CX LogP: 5.12CX LogD: 5.37Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.10Np Likeness Score: -1.54
References 1. Mukherjee H, Su N, Belmonte MA, Hargreaves D, Patel J, Tentarelli S, Aquila B, Grimster NP.. (2019) Discovery and optimization of covalent Bcl-xL antagonists., 29 (23): [PMID:31606346 ] [10.1016/j.bmcl.2019.126682 ]