The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(6-(4-(2-methoxyethoxy)phenyl)pyrazolo[1,5-a]pyrimidin-3-yl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide ID: ALA4593028
PubChem CID: 70841494
Max Phase: Preclinical
Molecular Formula: C22H19F3N4O3S
Molecular Weight: 476.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCOc1ccc(-c2cnc3c(-c4csc(C(=O)NCC(F)(F)F)c4)cnn3c2)cc1
Standard InChI: InChI=1S/C22H19F3N4O3S/c1-31-6-7-32-17-4-2-14(3-5-17)16-9-26-20-18(10-28-29(20)11-16)15-8-19(33-12-15)21(30)27-13-22(23,24)25/h2-5,8-12H,6-7,13H2,1H3,(H,27,30)
Standard InChI Key: BBEQRPZTAJPSME-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
6.5251 -9.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5251 -10.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2304 -10.8133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2304 -9.1790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9357 -9.5917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9357 -10.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7138 -10.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1949 -10.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7139 -9.3389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9680 -11.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4876 -12.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9679 -12.7664 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.7451 -12.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7451 -11.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4063 -12.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3208 -13.8070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1528 -12.6619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8139 -13.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5605 -12.8098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2216 -13.2902 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.6459 -11.9971 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2649 -12.3941 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.8186 -9.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8176 -8.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1095 -7.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4020 -8.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4071 -9.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1157 -9.5974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6926 -7.9677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9866 -8.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2772 -7.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5712 -8.3853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8618 -7.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
7 10 1 0
13 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
19 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
1 23 1 0
26 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.48Molecular Weight (Monoisotopic): 476.1130AlogP: 4.44#Rotatable Bonds: 8Polar Surface Area: 77.75Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.90CX Basic pKa: 0.98CX LogP: 3.69CX LogD: 3.69Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.86
References 1. Sloman DL, Noucti N, Altman MD, Chen D, Mislak AC, Szewczak A, Hayashi M, Warren L, Dellovade T, Wu Z, Marcus J, Walker D, Su HP, Edavettal SC, Munshi S, Hutton M, Nuthall H, Stanton MG.. (2016) Optimization of microtubule affinity regulating kinase (MARK) inhibitors with improved physical properties., 26 (17): [PMID:27491711 ] [10.1016/j.bmcl.2016.02.003 ]