The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(2-Hydroxy-3-((3-methoxy-4-(3-phenylpropoxy)-phenethyl)amino)propoxy)Benzene-1,2-diol ID: ALA4593181
PubChem CID: 146025803
Max Phase: Preclinical
Molecular Formula: C27H33NO6
Molecular Weight: 467.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CCNC[C@H](O)COc2ccc(O)c(O)c2)ccc1OCCCc1ccccc1
Standard InChI: InChI=1S/C27H33NO6/c1-32-27-16-21(9-12-26(27)33-15-5-8-20-6-3-2-4-7-20)13-14-28-18-22(29)19-34-23-10-11-24(30)25(31)17-23/h2-4,6-7,9-12,16-17,22,28-31H,5,8,13-15,18-19H2,1H3/t22-/m0/s1
Standard InChI Key: ZIKVQVRMNFIOLA-QFIPXVFZSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
27.0182 -27.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7331 -28.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4495 -27.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4466 -26.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1596 -26.3811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8756 -26.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5885 -26.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3045 -26.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0174 -26.3704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7334 -26.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0194 -26.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7294 -26.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3049 -26.3874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3035 -28.0393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4464 -26.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1623 -26.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1628 -27.5969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8780 -28.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5919 -27.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5861 -26.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8703 -26.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2975 -26.3444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3084 -28.0002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3127 -28.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0292 -29.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0334 -30.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7500 -30.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7514 -31.2928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4672 -31.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1804 -31.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1736 -30.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4573 -30.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5854 -25.5507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2916 -25.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 1 2 0
1 2 1 0
2 3 2 0
3 4 1 0
4 12 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 12 1 0
11 13 1 0
1 14 1 0
10 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
19 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
7 33 1 1
22 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.56Molecular Weight (Monoisotopic): 467.2308AlogP: 3.69#Rotatable Bonds: 14Polar Surface Area: 100.41Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.67CX Basic pKa: 9.06CX LogP: 3.77CX LogD: 2.49Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.21Np Likeness Score: -0.06
References 1. Stanek M, Picard LP, Schmidt MF, Kaindl JM, Hübner H, Bouvier M, Weikert D, Gmeiner P.. (2019) Hybridization of β-Adrenergic Agonists and Antagonists Confers G Protein Bias., 62 (10): [PMID:31042379 ] [10.1021/acs.jmedchem.9b00349 ]