(S)-4-(2-Hydroxy-3-((3-methoxy-4-(3-phenylpropoxy)-phenethyl)amino)propoxy)Benzene-1,2-diol

ID: ALA4593181

PubChem CID: 146025803

Max Phase: Preclinical

Molecular Formula: C27H33NO6

Molecular Weight: 467.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CCNC[C@H](O)COc2ccc(O)c(O)c2)ccc1OCCCc1ccccc1

Standard InChI:  InChI=1S/C27H33NO6/c1-32-27-16-21(9-12-26(27)33-15-5-8-20-6-3-2-4-7-20)13-14-28-18-22(29)19-34-23-10-11-24(30)25(31)17-23/h2-4,6-7,9-12,16-17,22,28-31H,5,8,13-15,18-19H2,1H3/t22-/m0/s1

Standard InChI Key:  ZIKVQVRMNFIOLA-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   27.0182  -27.6273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7331  -28.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4495  -27.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4466  -26.7963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1596  -26.3811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8756  -26.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5885  -26.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3045  -26.7855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0174  -26.3704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7334  -26.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0194  -26.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7294  -26.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3049  -26.3874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3035  -28.0393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.4464  -26.3649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1623  -26.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1628  -27.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8780  -28.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5919  -27.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5861  -26.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8703  -26.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2975  -26.3444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.3084  -28.0002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.3127  -28.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0292  -29.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0334  -30.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7500  -30.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7514  -31.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4672  -31.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1804  -31.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1736  -30.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4573  -30.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5854  -25.5507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2916  -25.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11  1  2  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4 12  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 12  1  0
 11 13  1  0
  1 14  1  0
 10 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 20 22  1  0
 19 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  7 33  1  1
 22 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4593181

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Adrb1 Beta-1 adrenergic receptor (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.56Molecular Weight (Monoisotopic): 467.2308AlogP: 3.69#Rotatable Bonds: 14
Polar Surface Area: 100.41Molecular Species: BASEHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.67CX Basic pKa: 9.06CX LogP: 3.77CX LogD: 2.49
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.21Np Likeness Score: -0.06

References

1. Stanek M, Picard LP, Schmidt MF, Kaindl JM, Hübner H, Bouvier M, Weikert D, Gmeiner P..  (2019)  Hybridization of β-Adrenergic Agonists and Antagonists Confers G Protein Bias.,  62  (10): [PMID:31042379] [10.1021/acs.jmedchem.9b00349]

Source