(S)-11-[(2R,8R,10S,11S)-2,8-Dihydroxy-4-methyl-7-oxo-11-((Z)-pent-2-enyl)-9-oxa-4-aza-tricyclo[6.3.1.0*1,5*]dodec-5-en-10-yl]-9-hydroxy-10-oxo-undecanoic acid

ID: ALA459341

PubChem CID: 44588343

Max Phase: Preclinical

Molecular Formula: C27H41NO8

Molecular Weight: 507.62

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC/C=C\C[C@@H]1[C@H](CC(=O)[C@@H](O)CCCCCCCC(=O)O)O[C@]2(O)CC13C(=CC2=O)N(C)C[C@@H]3O

Standard InChI:  InChI=1S/C27H41NO8/c1-3-4-8-11-18-21(14-20(30)19(29)12-9-6-5-7-10-13-25(33)34)36-27(35)17-26(18)22(15-23(27)31)28(2)16-24(26)32/h4,8,15,18-19,21,24,29,32,35H,3,5-7,9-14,16-17H2,1-2H3,(H,33,34)/b8-4-/t18-,19+,21+,24+,26?,27-/m1/s1

Standard InChI Key:  HXDCZOUEOAHBBC-GNRXNTNDSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   11.5412  -24.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2532  -24.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2532  -23.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5412  -22.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8250  -22.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2458  -22.5333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5277  -22.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0750  -23.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1094  -22.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1071  -21.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3916  -20.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6782  -21.3017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9626  -20.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5238  -21.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2364  -20.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2325  -20.0614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9528  -21.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9566  -22.1205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6653  -20.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3817  -21.2889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0942  -20.8730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8106  -21.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5232  -20.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2396  -21.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9521  -20.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6685  -21.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6738  -22.0949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3825  -20.8541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8292  -24.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8292  -23.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0402  -23.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5525  -23.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0402  -24.4396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9671  -24.5969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7852  -25.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3208  -22.6833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 15 17  1  0
  1  2  1  0
 17 18  1  6
  3  8  1  6
 17 19  1  0
  2  3  1  0
 19 20  1  0
  5  9  1  6
 20 21  1  0
  3  4  1  0
 21 22  1  0
  9 10  1  0
 22 23  1  0
 23 24  1  0
 10 11  2  0
 24 25  1  0
 30  5  1  0
 25 26  1  0
 11 12  1  0
 30  4  1  0
 26 27  1  0
 26 28  2  0
 29 30  1  0
 12 13  1  0
  3  6  1  0
  7 14  1  6
  5  7  1  0
 14 15  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 29  1  0
 29  1  2  0
  2 34  2  0
 15 16  2  0
 33 35  1  0
  6  7  1  0
 31 36  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA459341

   (9S)-11-[(2R,8R,10S,11S)-2,8-dihydroxy-4-methyl-7-oxo-11-[(Z)-pent-2-enyl]-9-oxa-4-azatricyclo[6.3.1.01,5]dodec-5-en-10-yl]-9-hydroxy-10-oxoundecanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 507.62

Molecular Weight (Monoisotopic): 507.2832

AlogP: 2.33

#Rotatable Bonds: 14

Polar Surface Area: 144.60

Molecular Species: ACID

HBA: 8

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 4.68

CX Basic pKa: ┄

CX LogP: 2.73

CX LogD: 0.07

Aromatic Rings: ┄

Heavy Atoms: 36

QED Weighted: 0.21

Np Likeness Score: 1.46

References

1. Kai K, Takeuchi J, Kataoka T, Yokoyama M, Watanabe N..  (2008)  Structure and biological activity of novel FN analogs as flowering inducers.,  16  (23): [PMID:18952445] [10.1016/j.bmc.2008.10.014]

Source

Source(1):

• Scientific Literature