2-((bis(2-chloroethyl)amino)(4-(trifluoromethoxy)phenyl)methyl)-1,4-dihydroxyanthracene-9,10-dione

ID: ALA4593714

PubChem CID: 141750625

Max Phase: Preclinical

Molecular Formula: C26H20Cl2F3NO5

Molecular Weight: 554.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2ccccc2C(=O)c2c(O)c(C(c3ccc(OC(F)(F)F)cc3)N(CCCl)CCCl)cc(O)c21

Standard InChI:  InChI=1S/C26H20Cl2F3NO5/c27-9-11-32(12-10-28)22(14-5-7-15(8-6-14)37-26(29,30)31)18-13-19(33)20-21(25(18)36)24(35)17-4-2-1-3-16(17)23(20)34/h1-8,13,22,33,36H,9-12H2

Standard InChI Key:  QKTBVOGFMVRFQZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    5.7859  -22.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7859  -20.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0806  -21.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0832  -20.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3794  -20.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6727  -20.9620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6741  -21.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3784  -22.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4912  -20.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4896  -21.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1938  -22.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9001  -21.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8977  -20.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1929  -20.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7845  -19.7323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7871  -23.0010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1931  -23.0021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1910  -19.7386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6041  -20.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6015  -19.7314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3096  -20.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3109  -21.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0191  -22.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7264  -21.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7212  -20.9461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0124  -20.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4360  -22.1729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3079  -19.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8925  -19.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8899  -18.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1809  -18.1015    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.3053  -18.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0117  -18.0925    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.4397  -22.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4465  -23.7353    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.7837  -23.5342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.1076  -23.5282    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 10  1  0
  9  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  2  0
  1 16  2  0
 11 17  1  0
 14 18  1  0
 13 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 24 27  1  0
 20 28  1  0
 20 29  1  0
 29 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  1  0
 27 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4593714

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 554.35Molecular Weight (Monoisotopic): 553.0671AlogP: 5.64#Rotatable Bonds: 8
Polar Surface Area: 87.07Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.85CX Basic pKa: 3.99CX LogP: 8.10CX LogD: 7.97
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: 0.08

References

1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X..  (2019)  Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents.,  29  (9): [PMID:30846253] [10.1016/j.bmcl.2019.02.026]

Source