The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((bis(2-chloroethyl)amino)(4-(trifluoromethoxy)phenyl)methyl)-1,4-dihydroxyanthracene-9,10-dione ID: ALA4593714
PubChem CID: 141750625
Max Phase: Preclinical
Molecular Formula: C26H20Cl2F3NO5
Molecular Weight: 554.35
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccccc2C(=O)c2c(O)c(C(c3ccc(OC(F)(F)F)cc3)N(CCCl)CCCl)cc(O)c21
Standard InChI: InChI=1S/C26H20Cl2F3NO5/c27-9-11-32(12-10-28)22(14-5-7-15(8-6-14)37-26(29,30)31)18-13-19(33)20-21(25(18)36)24(35)17-4-2-1-3-16(17)23(20)34/h1-8,13,22,33,36H,9-12H2
Standard InChI Key: QKTBVOGFMVRFQZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
5.7859 -22.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7859 -20.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0806 -21.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0832 -20.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3794 -20.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6727 -20.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6741 -21.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3784 -22.1850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4912 -20.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4896 -21.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1938 -22.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9001 -21.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8977 -20.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1929 -20.5558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7845 -19.7323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7871 -23.0010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1931 -23.0021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1910 -19.7386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6041 -20.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6015 -19.7314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3096 -20.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3109 -21.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0191 -22.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7264 -21.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7212 -20.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0124 -20.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4360 -22.1729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3079 -19.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8925 -19.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8899 -18.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1809 -18.1015 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.3053 -18.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0117 -18.0925 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.4397 -22.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4465 -23.7353 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.7837 -23.5342 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.1076 -23.5282 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 1 1 0
1 10 1 0
9 2 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
2 15 2 0
1 16 2 0
11 17 1 0
14 18 1 0
13 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
19 21 1 0
24 27 1 0
20 28 1 0
20 29 1 0
29 30 1 0
30 31 1 0
28 32 1 0
32 33 1 0
27 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.35Molecular Weight (Monoisotopic): 553.0671AlogP: 5.64#Rotatable Bonds: 8Polar Surface Area: 87.07Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.85CX Basic pKa: 3.99CX LogP: 8.10CX LogD: 7.97Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: 0.08
References 1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X.. (2019) Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents., 29 (9): [PMID:30846253 ] [10.1016/j.bmcl.2019.02.026 ]