(2-((4-tert-Butylbenzyl)(pyridin-3-ylsulfonyl)aminomethyl)-pyridin-4-ylamino)acetic Acid Hydrochloride

ID: ALA4593898

PubChem CID: 155569438

Max Phase: Preclinical

Molecular Formula: C24H29ClN4O4S

Molecular Weight: 468.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1ccc(CN(Cc2cc(NCC(=O)O)ccn2)S(=O)(=O)c2cccnc2)cc1.Cl

Standard InChI:  InChI=1S/C24H28N4O4S.ClH/c1-24(2,3)19-8-6-18(7-9-19)16-28(33(31,32)22-5-4-11-25-14-22)17-21-13-20(10-12-26-21)27-15-23(29)30;/h4-14H,15-17H2,1-3H3,(H,26,27)(H,29,30);1H

Standard InChI Key:  AGQWGWXLTCFGBM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
    9.0455  -13.0527    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.4125  -14.8914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5875  -14.8914    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0000  -15.6059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4485  -15.3122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4473  -16.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1622  -16.5524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8744  -16.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8716  -15.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1604  -14.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5855  -14.0685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2985  -13.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8696  -13.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8664  -12.8337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0144  -14.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5811  -12.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1465  -11.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1528  -12.4281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0127  -14.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7279  -15.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4418  -14.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4360  -14.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7203  -13.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1584  -15.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1625  -16.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8707  -14.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8707  -15.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8618  -11.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5753  -11.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2876  -11.1774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042  -11.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7165  -11.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4332  -11.5782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7119  -10.3447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9  3  1  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 12 15  1  0
 14 16  2  0
 16 29  1  0
 28 17  1  0
 17 18  2  0
 18 14  1  0
 15 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 15  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
M  END

Associated Targets(Human)

PTGER2 Tclin Prostanoid EP2 receptor (1730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.58Molecular Weight (Monoisotopic): 468.1831AlogP: 3.66#Rotatable Bonds: 9
Polar Surface Area: 112.49Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.06CX Basic pKa: 7.84CX LogP: 0.94CX LogD: 0.81
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -1.59

References

1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K..  (2018)  Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl.,  61  (15): [PMID:29995405] [10.1021/acs.jmedchem.8b00808]

Source