The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6,7-Dimethoxy-2-((4'-(3-((4-phenyl-1,2,5-oxadiazol-3-yl)oxy)-propoxy)biphen-4-yl)methyl)-1,2,3,4-tetrahydroisoquinoline ID: ALA4594088
PubChem CID: 155569529
Max Phase: Preclinical
Molecular Formula: C35H35N3O5
Molecular Weight: 577.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(Cc1ccc(-c3ccc(OCCCOc4nonc4-c4ccccc4)cc3)cc1)CC2
Standard InChI: InChI=1S/C35H35N3O5/c1-39-32-21-29-17-18-38(24-30(29)22-33(32)40-2)23-25-9-11-26(12-10-25)27-13-15-31(16-14-27)41-19-6-20-42-35-34(36-43-37-35)28-7-4-3-5-8-28/h3-5,7-16,21-22H,6,17-20,23-24H2,1-2H3
Standard InChI Key: AJGHMGHCQLOLQU-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
2.3511 -4.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3500 -4.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0580 -5.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0562 -3.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7648 -4.0864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7682 -4.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4806 -5.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1942 -4.9058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1908 -4.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4738 -3.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9030 -5.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6096 -4.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3145 -5.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0206 -4.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0188 -4.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3050 -3.6773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6018 -4.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7214 -3.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4310 -4.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1366 -3.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1337 -2.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4194 -2.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7167 -2.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8392 -2.4381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5491 -2.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2546 -2.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9645 -2.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6700 -2.4228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3799 -2.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4656 -3.6395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2658 -3.8051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6707 -3.0952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1205 -2.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6419 -5.3176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9345 -4.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6433 -3.6816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9357 -4.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2877 -1.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0647 -1.4365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2294 -0.6368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6182 -0.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8395 -0.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6784 -1.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 29 1 0
2 34 1 0
34 35 1 0
1 36 1 0
36 37 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
33 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.68Molecular Weight (Monoisotopic): 577.2577AlogP: 6.83#Rotatable Bonds: 12Polar Surface Area: 79.08Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.70CX LogP: 6.77CX LogD: 6.30Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.15Np Likeness Score: -0.81
References 1. Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A.. (2016) Structure-Activity Relationship Studies on Tetrahydroisoquinoline Derivatives: [4'-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol] (MC70) Conjugated through Flexible Alkyl Chains with Furazan Moieties Gives Rise to Potent and Selective Ligands of P-glycoprotein., 59 (14): [PMID:27336199 ] [10.1021/acs.jmedchem.6b00252 ]