(6-((4-(1-Ethylcyclobutyl)benzyl)(pyridin-3-ylsulfonyl)-aminomethyl)pyridin-2-ylamino)acetic Acid

ID: ALA4594090

PubChem CID: 53260293

Max Phase: Preclinical

Molecular Formula: C26H30N4O4S

Molecular Weight: 494.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC1(c2ccc(CN(Cc3cccc(NCC(=O)O)n3)S(=O)(=O)c3cccnc3)cc2)CCC1

Standard InChI:  InChI=1S/C26H30N4O4S/c1-2-26(13-5-14-26)21-11-9-20(10-12-21)18-30(35(33,34)23-7-4-15-27-16-23)19-22-6-3-8-24(29-22)28-17-25(31)32/h3-4,6-12,15-16H,2,5,13-14,17-19H2,1H3,(H,28,29)(H,31,32)

Standard InChI Key:  XZECEGGYSLNIAK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   14.1873  -13.0207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3623  -13.0207    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.7748  -13.7351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2234  -13.4414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2223  -14.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9370  -14.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6535  -14.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6507  -13.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9352  -13.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3605  -12.1977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0733  -11.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6444  -11.7878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6413  -10.9628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7894  -12.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3560  -10.5496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9215   -9.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9277  -10.5573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7877  -13.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5028  -13.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2167  -13.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2109  -12.1828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4951  -11.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6367   -9.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3503   -9.7230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0624   -9.3067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7792   -9.7152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4913   -9.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2081   -9.7074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4869   -8.4739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9329  -13.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1506  -14.2165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9463  -13.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7288  -13.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1414  -12.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9365  -12.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8  2  1  0
  2 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 11 14  1  0
 13 15  2  0
 15 24  1  0
 23 16  1  0
 16 17  2  0
 17 13  1  0
 14 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 14  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 30  1  0
 20 30  1  0
 30 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

PTGER2 Tclin Prostanoid EP2 receptor (1730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.62Molecular Weight (Monoisotopic): 494.1988AlogP: 4.20#Rotatable Bonds: 11
Polar Surface Area: 112.49Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.07CX Basic pKa: 5.67CX LogP: 1.63CX LogD: 0.31
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.19

References

1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K..  (2018)  Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl.,  61  (15): [PMID:29995405] [10.1021/acs.jmedchem.8b00808]

Source