4-Decyl-N-(4-methyl-3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)benzamide

ID: ALA462444

PubChem CID: 24971113

Max Phase: Preclinical

Molecular Formula: C32H39N5O

Molecular Weight: 509.70

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCc1ccc(C(=O)Nc2ccc(C)c(Nc3nc(-c4cccnc4)c[nH]3)c2)cc1

Standard InChI:  InChI=1S/C32H39N5O/c1-3-4-5-6-7-8-9-10-12-25-15-17-26(18-16-25)31(38)35-28-19-14-24(2)29(21-28)36-32-34-23-30(37-32)27-13-11-20-33-22-27/h11,13-23H,3-10,12H2,1-2H3,(H,35,38)(H2,34,36,37)

Standard InChI Key:  WUHDFSDEMJXQKB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   -1.2556    2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2568    1.8018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5419    1.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1745    1.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1716    2.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5437    3.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9702    3.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8896    1.3909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6034    1.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3186    1.3932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6021    2.6296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9716    1.3899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9722    0.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6428    0.0818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3884   -0.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5634   -0.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3080    0.0807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8702   -1.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6916   -1.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1768   -1.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8419   -2.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0170   -2.7854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5354   -2.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3152    0.5697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0295    0.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7443    0.5721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7403    1.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0255    1.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4599    0.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1732    0.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8889    0.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6021    0.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3178    0.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0311    0.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7467    0.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4600    0.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1757    0.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8889    0.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
  2  3  1  0
 21 22  1  0
  9 11  2  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
  5  6  2  0
 10 24  2  0
  2 12  1  0
 24 25  1  0
  6  1  1  0
 25 26  2  0
 12 13  1  0
 26 27  1  0
 13 14  2  0
 27 28  2  0
 28 10  1  0
  1  2  2  0
 26 29  1  0
  1  7  1  0
 29 30  1  0
  3  4  2  0
 30 31  1  0
  4  8  1  0
 31 32  1  0
 14 15  1  0
 32 33  1  0
 15 16  2  0
 33 34  1  0
 16 17  1  0
 34 35  1  0
 17 13  1  0
 35 36  1  0
 36 37  1  0
  8  9  1  0
 37 38  1  0
M  END

Associated Targets(Human)

FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Pdgfrb Platelet-derived growth factor receptor (285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 509.70Molecular Weight (Monoisotopic): 509.3155AlogP: 8.46#Rotatable Bonds: 14
Polar Surface Area: 82.70Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.14CX Basic pKa: 7.53CX LogP: 8.91CX LogD: 8.56
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.15Np Likeness Score: -1.08

References

1. Mahboobi S, Sellmer A, Eswayah A, Elz S, Uecker A, Böhmer FD..  (2008)  Inhibition of PDGFR tyrosine kinase activity by a series of novel N-(3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)amides: a SAR study on the bioisosterism of pyrimidine and imidazole.,  43  (7): [PMID:17983688] [10.1016/j.ejmech.2007.09.021]

Source