The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Decyl-N-(4-methyl-3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)benzamide ID: ALA462444
PubChem CID: 24971113
Max Phase: Preclinical
Molecular Formula: C32H39N5O
Molecular Weight: 509.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCc1ccc(C(=O)Nc2ccc(C)c(Nc3nc(-c4cccnc4)c[nH]3)c2)cc1
Standard InChI: InChI=1S/C32H39N5O/c1-3-4-5-6-7-8-9-10-12-25-15-17-26(18-16-25)31(38)35-28-19-14-24(2)29(21-28)36-32-34-23-30(37-32)27-13-11-20-33-22-27/h11,13-23H,3-10,12H2,1-2H3,(H,35,38)(H2,34,36,37)
Standard InChI Key: WUHDFSDEMJXQKB-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
-1.2556 2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2568 1.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5419 1.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1745 1.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1716 2.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5437 3.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9702 3.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8896 1.3909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6034 1.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3186 1.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6021 2.6296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9716 1.3899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9722 0.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6428 0.0818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3884 -0.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5634 -0.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3080 0.0807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8702 -1.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6916 -1.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1768 -1.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8419 -2.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0170 -2.7854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5354 -2.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3152 0.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0295 0.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7443 0.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7403 1.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0255 1.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4599 0.1617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1732 0.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8889 0.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6021 0.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3178 0.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0311 0.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7467 0.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4600 0.5887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1757 0.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8889 0.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 19 2 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 2 0
2 3 1 0
21 22 1 0
9 11 2 0
22 23 2 0
23 18 1 0
15 18 1 0
5 6 2 0
10 24 2 0
2 12 1 0
24 25 1 0
6 1 1 0
25 26 2 0
12 13 1 0
26 27 1 0
13 14 2 0
27 28 2 0
28 10 1 0
1 2 2 0
26 29 1 0
1 7 1 0
29 30 1 0
3 4 2 0
30 31 1 0
4 8 1 0
31 32 1 0
14 15 1 0
32 33 1 0
15 16 2 0
33 34 1 0
16 17 1 0
34 35 1 0
17 13 1 0
35 36 1 0
36 37 1 0
8 9 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.70Molecular Weight (Monoisotopic): 509.3155AlogP: 8.46#Rotatable Bonds: 14Polar Surface Area: 82.70Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.14CX Basic pKa: 7.53CX LogP: 8.91CX LogD: 8.56Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.15Np Likeness Score: -1.08
References 1. Mahboobi S, Sellmer A, Eswayah A, Elz S, Uecker A, Böhmer FD.. (2008) Inhibition of PDGFR tyrosine kinase activity by a series of novel N-(3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)amides: a SAR study on the bioisosterism of pyrimidine and imidazole., 43 (7): [PMID:17983688 ] [10.1016/j.ejmech.2007.09.021 ]