The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4-(1H-benzo[d]imidazol-2-yl)phenethyl)phenyl)-N-isopropyl-1H-benzo[d]imidazole-5-carboximidamide ID: ALA462451
PubChem CID: 44565219
Max Phase: Preclinical
Molecular Formula: C32H30N6
Molecular Weight: 498.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NC(=N)c1ccc2[nH]c(-c3ccc(CCc4ccc(-c5nc6ccccc6[nH]5)cc4)cc3)nc2c1
Standard InChI: InChI=1S/C32H30N6/c1-20(2)34-30(33)25-17-18-28-29(19-25)38-32(37-28)24-15-11-22(12-16-24)8-7-21-9-13-23(14-10-21)31-35-26-5-3-4-6-27(26)36-31/h3-6,9-20H,7-8H2,1-2H3,(H2,33,34)(H,35,36)(H,37,38)
Standard InChI Key: DALZQMDCMBVXHC-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-1.9273 -11.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4123 -12.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4123 -10.7651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1969 -11.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1969 -11.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9113 -12.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6258 -11.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6258 -11.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9113 -10.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1023 -11.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7837 -11.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7837 -12.5596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0692 -12.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0692 -11.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3547 -11.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3547 -12.5596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5701 -12.8145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0852 -12.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5701 -11.4796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2602 -12.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8477 -12.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6102 -12.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0227 -11.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0227 -12.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8477 -11.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7852 -12.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3727 -11.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4981 -11.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2126 -11.7346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4981 -10.4971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2126 -10.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2126 -9.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9271 -10.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5477 -11.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1352 -10.7181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6898 -10.7181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6898 -12.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1352 -12.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 19 2 0
19 15 1 0
9 4 1 0
18 20 1 0
20 21 2 0
1 2 1 0
22 23 1 0
4 5 2 0
2 5 1 0
11 12 2 0
5 6 1 0
20 25 1 0
21 24 1 0
24 22 2 0
23 25 2 0
12 13 1 0
22 26 1 0
13 16 2 0
26 27 1 0
4 3 1 0
11 28 1 0
15 14 2 0
28 29 2 0
14 11 1 0
28 30 1 0
15 16 1 0
30 31 1 0
6 7 2 0
31 32 1 0
3 1 2 0
31 33 1 0
7 8 1 0
27 34 1 0
34 35 2 0
8 9 2 0
35 36 1 0
36 10 2 0
16 17 1 0
10 37 1 0
17 18 1 0
37 38 2 0
38 34 1 0
10 1 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.63Molecular Weight (Monoisotopic): 498.2532AlogP: 6.88#Rotatable Bonds: 7Polar Surface Area: 93.24Molecular Species: BASEHBA: 3HBD: 4#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.22CX Basic pKa: 10.41CX LogP: 6.76CX LogD: 4.77Aromatic Rings: 6Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -0.59
References 1. Hu L, Kully ML, Boykin DW, Abood N.. (2009) Synthesis and in vitro activity of dicationic bis-benzimidazoles as a new class of anti-MRSA and anti-VRE agents., 19 (5): [PMID:19208475 ] [10.1016/j.bmcl.2009.01.075 ]