N-(4-Methyl-3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)-4-((4-methylpiperazin-1-yl)methyl)benzamide

ID: ALA462642

PubChem CID: 24971163

Max Phase: Preclinical

Molecular Formula: C28H31N7O

Molecular Weight: 481.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nc(-c2cccnc2)c[nH]1

Standard InChI:  InChI=1S/C28H31N7O/c1-20-5-10-24(16-25(20)32-28-30-18-26(33-28)23-4-3-11-29-17-23)31-27(36)22-8-6-21(7-9-22)19-35-14-12-34(2)13-15-35/h3-11,16-18H,12-15,19H2,1-2H3,(H,31,36)(H2,30,32,33)

Standard InChI Key:  HAXKFZIHPSXYLR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    8.1569   -3.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1558   -4.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8706   -4.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5870   -4.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5842   -3.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8688   -3.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4424   -3.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3022   -4.9591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0160   -4.5454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0147   -3.7204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4410   -4.9601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4403   -5.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7698   -6.2682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0241   -7.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8492   -7.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1046   -6.2693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5386   -7.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7311   -4.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7209   -7.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2356   -8.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5704   -9.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3954   -9.1354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8770   -8.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7277   -5.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4420   -6.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1568   -5.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1528   -4.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4379   -4.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8725   -6.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8749   -7.0132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1583   -7.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1587   -8.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8726   -8.6580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5877   -8.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5889   -7.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8719   -9.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  9 18  1  0
  4  5  1  0
 17 19  2  0
  2  3  1  0
 19 20  1  0
  9 10  2  0
 20 21  2  0
  5  6  2  0
 21 22  1  0
  2 11  1  0
 22 23  2  0
 23 17  1  0
  6  1  1  0
 18 24  2  0
 11 12  1  0
 24 25  1  0
 12 13  2  0
 25 26  2  0
  1  2  2  0
 26 27  1  0
  1  7  1  0
 27 28  2  0
 28 18  1  0
  3  4  2  0
 26 29  1  0
  4  8  1  0
 29 30  1  0
 30 31  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 14 17  1  0
 33 36  1  0
M  END

Associated Targets(Human)

FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Pdgfrb Platelet-derived growth factor receptor (285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 481.60Molecular Weight (Monoisotopic): 481.2590AlogP: 4.52#Rotatable Bonds: 7
Polar Surface Area: 89.18Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.14CX Basic pKa: 8.01CX LogP: 4.19CX LogD: 3.26
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.70

References

1. Mahboobi S, Sellmer A, Eswayah A, Elz S, Uecker A, Böhmer FD..  (2008)  Inhibition of PDGFR tyrosine kinase activity by a series of novel N-(3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)amides: a SAR study on the bioisosterism of pyrimidine and imidazole.,  43  (7): [PMID:17983688] [10.1016/j.ejmech.2007.09.021]

Source