N-((S)-1-oxo-1-((S)-5-oxohex-3-en-2-ylamino)-3-phenylpropan-2-yl)-1-(5-((3aR,4R,6aS)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)-3,6,9,12-tetraoxapentadecan-15-amide

ID: ALA462927

PubChem CID: 44563919

Max Phase: Preclinical

Molecular Formula: C36H55N5O9S

Molecular Weight: 733.93

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)/C=C/[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)CCOCCOCCOCCOCCNC(=O)CCCC[C@H]1SC[C@H]2NC(=O)N[C@H]21

Standard InChI:  InChI=1S/C36H55N5O9S/c1-26(12-13-27(2)42)38-35(45)29(24-28-8-4-3-5-9-28)39-33(44)14-16-47-18-20-49-22-23-50-21-19-48-17-15-37-32(43)11-7-6-10-31-34-30(25-51-31)40-36(46)41-34/h3-5,8-9,12-13,26,29-31,34H,6-7,10-11,14-25H2,1-2H3,(H,37,43)(H,38,45)(H,39,44)(H2,40,41,46)/b13-12+/t26-,29-,30+,31+,34+/m0/s1

Standard InChI Key:  MOJDLDAOMUVHLX-IJTFITSESA-N

Molfile:  

     RDKit          2D

 53 55  0  0  0  0  0  0  0  0999 V2000
   -4.8780  -10.6759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9843   -9.6969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7868   -9.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724  -10.4076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1550  -10.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7258  -11.7367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9192  -11.5688    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8213  -10.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0169   -9.8018    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6892  -11.6271    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3952   -9.2999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1106  -10.3415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3918  -10.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6789  -10.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0329  -10.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7473  -10.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4582  -10.7579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7473   -9.5222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1729  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8879  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6027  -10.3461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3134  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0283  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7390  -10.7580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4538  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1687  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8836  -10.3461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5943  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3091  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0198  -10.7580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4496  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1644  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1644   -9.5222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8751  -10.7580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5900  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3049  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5900   -9.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3049   -9.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0156   -9.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7304   -9.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7304   -8.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0156   -7.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3049   -8.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3049  -11.5818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0156  -10.3461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7304  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4412  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7304  -11.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1561  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8710  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5858  -10.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8710   -9.5222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7347  -10.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  1  0
  4  2  1  0
  2  3  1  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  4  9  1  6
  5 10  1  6
  3 11  2  0
  8 12  1  1
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  1  1
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  2  0
 43 38  1  0
 36 44  2  0
 36 45  1  0
 45 46  1  0
 46 47  1  0
 46 48  1  6
 47 49  2  0
 49 50  1  0
 50 51  1  0
 50 52  2  0
 31 53  1  0
 53 30  1  0
M  END

Associated Targets(Human)

CTSB Tchem Cathepsin B (3822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Ctsb Cathepsin B (24 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 733.93Molecular Weight (Monoisotopic): 733.3720AlogP: 1.66#Rotatable Bonds: 27
Polar Surface Area: 182.42Molecular Species: NEUTRALHBA: 10HBD: 5
#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.60CX Basic pKa: CX LogP: 0.70CX LogD: 0.70
Aromatic Rings: 1Heavy Atoms: 51QED Weighted: 0.05Np Likeness Score: -0.19

References

1. Yang Z, Fonović M, Verhelst SH, Blum G, Bogyo M..  (2009)  Evaluation of alpha,beta-unsaturated ketone-based probes for papain-family cysteine proteases.,  17  (3): [PMID:18343672] [10.1016/j.bmc.2008.02.089]

Source