(3''R,4''S)-(3'''R,4'''S)-2',4',6'-trihydroxy-3',5'-bis(4-isopropyl-1-methylcyclohex-1-en-3-yl)-dihydrochalcone

ID: ALA463218

PubChem CID: 44559464

Max Phase: Preclinical

Molecular Formula: C35H46O4

Molecular Weight: 530.75

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C[C@H](c2c(O)c(C(=O)CCc3ccccc3)c(O)c([C@H]3C=C(C)CC[C@H]3C(C)C)c2O)[C@H](C(C)C)CC1

Standard InChI:  InChI=1S/C35H46O4/c1-20(2)25-15-12-22(5)18-27(25)30-33(37)31(28-19-23(6)13-16-26(28)21(3)4)35(39)32(34(30)38)29(36)17-14-24-10-8-7-9-11-24/h7-11,18-21,25-28,37-39H,12-17H2,1-6H3/t25-,26-,27-,28-/m0/s1

Standard InChI Key:  FQRJPQZSBBWOMS-LJWNLINESA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   -0.8889   -1.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8901   -2.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1753   -2.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5412   -2.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5383   -1.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1771   -0.7914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1772    0.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5379    0.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5374    1.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1765    1.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8915    1.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8927    0.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6036   -2.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3176   -2.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0303   -2.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0352   -3.2636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3212   -3.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6023   -3.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6035   -0.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1755   -3.2694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2512   -0.7853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2563   -2.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2576   -3.2674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9701   -2.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6852   -2.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3990   -2.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1129   -2.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8262   -2.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8253   -1.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1052   -0.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3948   -1.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2526    0.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7428   -2.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6058    1.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9668    0.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9625   -0.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8886   -3.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8900   -4.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1792   -4.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  1 19  1  0
  5  6  2  0
  3 20  1  0
  7 12  1  0
  5 21  1  0
  8  9  1  0
  4 22  1  0
  9 10  1  0
 22 23  2  0
 10 11  1  0
 22 24  1  0
 11 12  2  0
 24 25  1  0
  7  6  1  1
 25 26  1  0
 13 14  1  0
 26 27  2  0
  6  1  1  0
 27 28  1  0
  7  8  1  0
 28 29  2  0
  1  2  2  0
 29 30  1  0
  3  4  2  0
 30 31  2  0
 31 26  1  0
  8 32  1  1
  4  5  1  0
 15 33  1  0
 13 18  1  0
 11 34  1  0
 14 15  2  0
 32 35  1  0
 15 16  1  0
 32 36  1  0
 16 17  1  0
 18 37  1  6
 17 18  1  0
 37 38  1  0
 13  2  1  6
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA463218

    NEOLINDERATIN

Associated Targets(Human)

NSCLC (640 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.75Molecular Weight (Monoisotopic): 530.3396AlogP: 8.81#Rotatable Bonds: 8
Polar Surface Area: 77.76Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.55CX Basic pKa: CX LogP: 10.23CX LogD: 10.00
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: 1.15

References

1. Benosman A, Oger J, Richomme P, Bruneton J, Roussakis C, Ito K, Ichino K, Hamid A. Hadi A.  (1997)  New Terpenylated Dihydrochalcone Derivatives Isolated from Mitrella kentii ,  60  (9): [10.1021/np9700331]

Source