The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3''R,4''S)-(3'''R,4'''S)-2',4',6'-trihydroxy-3',5'-bis(4-isopropyl-1-methylcyclohex-1-en-3-yl)-dihydrochalcone ID: ALA463218
PubChem CID: 44559464
Max Phase: Preclinical
Molecular Formula: C35H46O4
Molecular Weight: 530.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C[C@H](c2c(O)c(C(=O)CCc3ccccc3)c(O)c([C@H]3C=C(C)CC[C@H]3C(C)C)c2O)[C@H](C(C)C)CC1
Standard InChI: InChI=1S/C35H46O4/c1-20(2)25-15-12-22(5)18-27(25)30-33(37)31(28-19-23(6)13-16-26(28)21(3)4)35(39)32(34(30)38)29(36)17-14-24-10-8-7-9-11-24/h7-11,18-21,25-28,37-39H,12-17H2,1-6H3/t25-,26-,27-,28-/m0/s1
Standard InChI Key: FQRJPQZSBBWOMS-LJWNLINESA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
-0.8889 -1.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8901 -2.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1753 -2.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5412 -2.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5383 -1.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1771 -0.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1772 0.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5379 0.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5374 1.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1765 1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8915 1.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8927 0.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6036 -2.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3176 -2.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0303 -2.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0352 -3.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3212 -3.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6023 -3.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6035 -0.7918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1755 -3.2694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2512 -0.7853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2563 -2.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2576 -3.2674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9701 -2.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6852 -2.4402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3990 -2.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1129 -2.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8262 -2.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8253 -1.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1052 -0.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3948 -1.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2526 0.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7428 -2.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6058 1.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9668 0.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9625 -0.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8886 -3.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8900 -4.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1792 -4.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
1 19 1 0
5 6 2 0
3 20 1 0
7 12 1 0
5 21 1 0
8 9 1 0
4 22 1 0
9 10 1 0
22 23 2 0
10 11 1 0
22 24 1 0
11 12 2 0
24 25 1 0
7 6 1 1
25 26 1 0
13 14 1 0
26 27 2 0
6 1 1 0
27 28 1 0
7 8 1 0
28 29 2 0
1 2 2 0
29 30 1 0
3 4 2 0
30 31 2 0
31 26 1 0
8 32 1 1
4 5 1 0
15 33 1 0
13 18 1 0
11 34 1 0
14 15 2 0
32 35 1 0
15 16 1 0
32 36 1 0
16 17 1 0
18 37 1 6
17 18 1 0
37 38 1 0
13 2 1 6
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.75Molecular Weight (Monoisotopic): 530.3396AlogP: 8.81#Rotatable Bonds: 8Polar Surface Area: 77.76Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.55CX Basic pKa: ┄CX LogP: 10.23CX LogD: 10.00Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: 1.15
References 1. Benosman A, Oger J, Richomme P, Bruneton J, Roussakis C, Ito K, Ichino K, Hamid A. Hadi A. (1997) New Terpenylated Dihydrochalcone Derivatives Isolated from Mitrella kentii , 60 (9): [10.1021/np9700331 ]