The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[(1S)-1-[4-[(2S)-2-(benzenesulfonamido)-3-hydroxy-propanoyl]piperazine-1-carbonyl]-3-methyl-butyl]benzothiophene-2-carboxamide ID: ALA4632531
PubChem CID: 23630401
Max Phase: Preclinical
Molecular Formula: C28H34N4O6S2
Molecular Weight: 586.74
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)c1cc2ccccc2s1)C(=O)N1CCN(C(=O)[C@H](CO)NS(=O)(=O)c2ccccc2)CC1
Standard InChI: InChI=1S/C28H34N4O6S2/c1-19(2)16-22(29-26(34)25-17-20-8-6-7-11-24(20)39-25)27(35)31-12-14-32(15-13-31)28(36)23(18-33)30-40(37,38)21-9-4-3-5-10-21/h3-11,17,19,22-23,30,33H,12-16,18H2,1-2H3,(H,29,34)/t22-,23-/m0/s1
Standard InChI Key: BOLAVWPLWAXOOZ-GOTSBHOMSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
25.2009 -15.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9186 -14.9596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6320 -15.3704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6320 -16.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9186 -16.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2009 -16.1961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4878 -16.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4878 -17.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2009 -17.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2009 -18.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9183 -19.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4878 -19.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7746 -17.8469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7746 -18.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1851 -19.3853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9770 -18.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6836 -19.6531 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.8563 -19.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6469 -18.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3357 -18.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8449 -18.6007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2669 -19.1847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4813 -19.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2746 -20.1928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7746 -16.1961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3451 -14.9598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3451 -14.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6320 -13.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9189 -14.1345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0625 -13.7197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0625 -12.8944 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.7757 -12.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7760 -11.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4866 -11.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2042 -11.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2023 -12.4807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4931 -12.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8483 -12.0988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2637 -12.6847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0625 -15.3704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 6
9 10 1 0
10 11 1 0
10 12 1 0
8 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
17 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
18 24 1 0
7 25 2 0
3 26 1 0
26 27 1 0
27 28 1 6
28 29 1 0
27 30 1 0
30 31 1 0
31 32 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
31 38 2 0
31 39 2 0
26 40 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.74Molecular Weight (Monoisotopic): 586.1920AlogP: 2.06#Rotatable Bonds: 10Polar Surface Area: 136.12Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.14CX Basic pKa: ┄CX LogP: 2.10CX LogD: 2.10Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -1.14