N-[(1S)-1-[4-[(2S)-2-(benzenesulfonamido)-3-hydroxy-propanoyl]piperazine-1-carbonyl]-3-methyl-butyl]benzothiophene-2-carboxamide

ID: ALA4632531

PubChem CID: 23630401

Max Phase: Preclinical

Molecular Formula: C28H34N4O6S2

Molecular Weight: 586.74

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)c1cc2ccccc2s1)C(=O)N1CCN(C(=O)[C@H](CO)NS(=O)(=O)c2ccccc2)CC1

Standard InChI:  InChI=1S/C28H34N4O6S2/c1-19(2)16-22(29-26(34)25-17-20-8-6-7-11-24(20)39-25)27(35)31-12-14-32(15-13-31)28(36)23(18-33)30-40(37,38)21-9-4-3-5-10-21/h3-11,17,19,22-23,30,33H,12-16,18H2,1-2H3,(H,29,34)/t22-,23-/m0/s1

Standard InChI Key:  BOLAVWPLWAXOOZ-GOTSBHOMSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   25.2009  -15.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9186  -14.9596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6320  -15.3704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6320  -16.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9186  -16.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2009  -16.1961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4878  -16.6067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4878  -17.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2009  -17.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2009  -18.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9183  -19.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4878  -19.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7746  -17.8469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7746  -18.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1851  -19.3853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.9770  -18.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6836  -19.6531    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.8563  -19.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6469  -18.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3357  -18.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8449  -18.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2669  -19.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4813  -19.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2746  -20.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7746  -16.1961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3451  -14.9598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3451  -14.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6320  -13.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9189  -14.1345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0625  -13.7197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0625  -12.8944    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.7757  -12.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7760  -11.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4866  -11.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2042  -11.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2023  -12.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4931  -12.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8483  -12.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2637  -12.6847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0625  -15.3704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
 10 12  1  0
  8 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 17 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 18 24  1  0
  7 25  2  0
  3 26  1  0
 26 27  1  0
 27 28  1  6
 28 29  1  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 32 37  1  0
 31 38  2  0
 31 39  2  0
 26 40  2  0
M  END

Associated Targets(non-human)

Trpv4 Transient receptor potential cation channel subfamily V member 4 (46 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 586.74Molecular Weight (Monoisotopic): 586.1920AlogP: 2.06#Rotatable Bonds: 10
Polar Surface Area: 136.12Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.14CX Basic pKa: CX LogP: 2.10CX LogD: 2.10
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -1.14

References

1. Lawhorn BG, Brnardic EJ, Behm DJ..  (2020)  Recent advances in TRPV4 agonists and antagonists.,  30  (8): [PMID:32063431] [10.1016/j.bmcl.2020.127022]

Source