The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-N-(1-(2-((4-cyano)phenylamino)benzoyl)piperidin-4-yl)-2-trifluoromethyl-4-fluoro-benzamide ID: ALA4632758
PubChem CID: 156009810
Max Phase: Preclinical
Molecular Formula: C28H24F4N4O2
Molecular Weight: 524.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C(=O)c1ccc(F)cc1C(F)(F)F)C1CCN(C(=O)c2ccccc2Nc2ccc(C#N)cc2)CC1
Standard InChI: InChI=1S/C28H24F4N4O2/c1-35(26(37)22-11-8-19(29)16-24(22)28(30,31)32)21-12-14-36(15-13-21)27(38)23-4-2-3-5-25(23)34-20-9-6-18(17-33)7-10-20/h2-11,16,21,34H,12-15H2,1H3
Standard InChI Key: NNTRWHBIVTUJEX-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
16.8019 -5.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6214 -5.0419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0325 -4.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6210 -3.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7983 -3.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3951 -4.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3935 -5.7527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0336 -5.7541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6203 -6.4615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8549 -5.7547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2593 -6.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0771 -6.4668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4942 -5.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0832 -5.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2593 -5.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3155 -5.7650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7209 -6.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7273 -5.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3090 -7.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5422 -6.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4898 -7.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0739 -7.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4834 -8.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3090 -8.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7170 -7.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5763 -5.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1685 -5.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3521 -5.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9446 -5.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3595 -6.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1746 -6.4622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0732 -9.3084 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5342 -7.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9431 -8.6004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.9426 -7.1850 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.3477 -7.8913 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.1305 -5.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3133 -5.7658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
16 17 1 0
16 18 1 0
17 19 1 0
17 20 2 0
19 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 19 1 0
7 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
23 32 1 0
25 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
37 38 3 0
29 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.52Molecular Weight (Monoisotopic): 524.1835AlogP: 5.84#Rotatable Bonds: 5Polar Surface Area: 76.44Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.00CX LogD: 6.00Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.43Np Likeness Score: -1.82
References 1. Ji D, Zhang W, Xu Y, Zhang JJ.. (2020) Design, synthesis and biological evaluation of anthranilamide derivatives as potent SMO inhibitors., 28 (6): [PMID:32063403 ] [10.1016/j.bmc.2020.115354 ]