16alpha-Bromoepiandrosterone isobutyrate

ID: ALA4633426

PubChem CID: 156010978

Max Phase: Preclinical

Molecular Formula: C23H35BrO3

Molecular Weight: 439.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)[C@H](Br)C[C@@H]32)C1

Standard InChI:  InChI=1S/C23H35BrO3/c1-13(2)21(26)27-15-7-9-22(3)14(11-15)5-6-16-17(22)8-10-23(4)18(16)12-19(24)20(23)25/h13-19H,5-12H2,1-4H3/t14-,15-,16+,17-,18-,19+,22-,23-/m0/s1

Standard InChI Key:  USMTZMDOIACZQT-QGPRHCATSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    8.6236  -19.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2702  -21.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2702  -22.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9828  -22.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9828  -20.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6878  -21.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6878  -22.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3989  -22.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1145  -22.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3989  -20.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1143  -21.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1166  -19.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8321  -19.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8270  -20.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6106  -21.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1017  -20.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8191  -21.5956    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3929  -21.5914    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6798  -22.8269    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3908  -19.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1101  -20.3560    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6798  -20.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8821  -18.9124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8273  -19.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5595  -22.4168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5599  -23.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8457  -23.6547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2746  -23.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2751  -24.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9889  -23.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9267  -20.3742    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  2  5  1  0
  3  4  1  0
  4  7  1  0
  6  5  1  0
  6  7  1  0
  6 10  1  0
  7  8  1  0
  8  9  1  0
  9 11  1  0
 10 11  1  0
 10 20  1  0
 11 14  1  0
 13 12  1  0
 12 20  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16  1  1  0
  1 13  1  0
 14 17  1  6
 10 18  1  6
  7 19  1  6
 11 21  1  1
  6 22  1  1
  1 23  2  0
 13 24  1  1
  3 25  1  1
 25 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 16 31  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4633426

    ---

Associated Targets(Human)

G6PD Tchem Glucose-6-phosphate 1-dehydrogenase (778 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.43Molecular Weight (Monoisotopic): 438.1770AlogP: 5.54#Rotatable Bonds: 2
Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.12CX LogD: 6.12
Aromatic Rings: Heavy Atoms: 27QED Weighted: 0.42Np Likeness Score: 2.07

References

1. Fredo Naciuk F, do Nascimento Faria J, Gonçalves Eufrásio A, Torres Cordeiro A, Bruder M..  (2020)  Development of Selective Steroid Inhibitors for the Glucose-6-phosphate Dehydrogenase from Trypanosoma cruzi.,  11  (6): [PMID:32551008] [10.1021/acsmedchemlett.0c00106]

Source