The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
16alpha-Bromoepiandrosterone isobutyrate ID: ALA4633426
PubChem CID: 156010978
Max Phase: Preclinical
Molecular Formula: C23H35BrO3
Molecular Weight: 439.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)[C@H](Br)C[C@@H]32)C1
Standard InChI: InChI=1S/C23H35BrO3/c1-13(2)21(26)27-15-7-9-22(3)14(11-15)5-6-16-17(22)8-10-23(4)18(16)12-19(24)20(23)25/h13-19H,5-12H2,1-4H3/t14-,15-,16+,17-,18-,19+,22-,23-/m0/s1
Standard InChI Key: USMTZMDOIACZQT-QGPRHCATSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
8.6236 -19.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2702 -21.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2702 -22.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9828 -22.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9828 -20.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6878 -21.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6878 -22.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3989 -22.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1145 -22.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3989 -20.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1143 -21.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1166 -19.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8321 -19.9480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8270 -20.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6106 -21.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1017 -20.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8191 -21.5956 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.3929 -21.5914 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.6798 -22.8269 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.3908 -19.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1101 -20.3560 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.6798 -20.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8821 -18.9124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8273 -19.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5595 -22.4168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5599 -23.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8457 -23.6547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2746 -23.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2751 -24.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9889 -23.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9267 -20.3742 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 5 1 0
3 4 1 0
4 7 1 0
6 5 1 0
6 7 1 0
6 10 1 0
7 8 1 0
8 9 1 0
9 11 1 0
10 11 1 0
10 20 1 0
11 14 1 0
13 12 1 0
12 20 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 1 1 0
1 13 1 0
14 17 1 6
10 18 1 6
7 19 1 6
11 21 1 1
6 22 1 1
1 23 2 0
13 24 1 1
3 25 1 1
25 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
28 30 1 0
16 31 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.43Molecular Weight (Monoisotopic): 438.1770AlogP: 5.54#Rotatable Bonds: 2Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.12CX LogD: 6.12Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.42Np Likeness Score: 2.07
References 1. Fredo Naciuk F, do Nascimento Faria J, Gonçalves Eufrásio A, Torres Cordeiro A, Bruder M.. (2020) Development of Selective Steroid Inhibitors for the Glucose-6-phosphate Dehydrogenase from Trypanosoma cruzi ., 11 (6): [PMID:32551008 ] [10.1021/acsmedchemlett.0c00106 ]