(2R,4S)-1-((R)-2-(10-(4-(4-((3-((3-Amino-5-(4-amino-4-methylpiperidin-1-yl)pyrazin-2-yl)thio)-2-chlorophenyl)amino)-4-oxobutanoyl)piperazin-1-yl)decanamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-((R)-1-(4-(4-methylthiazol-5-yl)phenyl)ethyl)-pyrrolidine-2-carboxamide

ID: ALA4633445

PubChem CID: 156009511

Max Phase: Preclinical

Molecular Formula: C57H81ClN12O6S2

Molecular Weight: 1129.94

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  Cc1ncsc1-c1ccc([C@H](C)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCCCCCCCCN2CCN(C(=O)CCC(=O)Nc3cccc(Sc4ncc(N5CCC(C)(N)CC5)nc4N)c3Cl)CC2)C(C)(C)C)cc1

Standard InChI:  InChI=1S/C57H81ClN12O6S2/c1-37(39-18-20-40(21-19-39)50-38(2)62-36-77-50)63-53(75)43-33-41(71)35-70(43)55(76)51(56(3,4)5)66-46(72)17-12-10-8-7-9-11-13-26-67-29-31-69(32-30-67)48(74)23-22-47(73)64-42-15-14-16-44(49(42)58)78-54-52(59)65-45(34-61-54)68-27-24-57(6,60)25-28-68/h14-16,18-21,34,36-37,41,43,51,71H,7-13,17,22-33,35,60H2,1-6H3,(H2,59,65)(H,63,75)(H,64,73)(H,66,72)/t37-,41+,43-,51+/m0/s1

Standard InChI Key:  BXQHTANMKACEKS-KLBUFCEUSA-N

Molfile:  

 
     RDKit          2D

 78 84  0  0  0  0  0  0  0  0999 V2000
   25.4910   -5.5490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2094   -5.1445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2190   -4.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9168   -5.5617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9326   -3.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5115   -3.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2258   -3.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9107   -6.3846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6339   -5.1583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3770   -5.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9315   -4.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5280   -4.1742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7216   -4.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7705   -6.2150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5874   -6.2353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3424   -6.9159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8693   -3.4272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9819   -6.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8024   -6.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5538   -7.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7314   -7.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3034   -8.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6978   -9.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5226   -9.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9470   -8.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2706   -9.7559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4548   -9.8247    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.2676  -10.6255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9691  -11.0527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5910  -10.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3901  -10.7057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9518   -5.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7726   -4.5042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7753   -5.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4894   -5.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2013   -5.3207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1945   -4.4939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4799   -4.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4736   -3.2707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9029   -4.0793    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.6182   -4.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6218   -5.3009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3321   -5.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0414   -5.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0318   -4.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3168   -4.0644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3056   -3.2432    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.7387   -4.0461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0651   -5.7434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3553   -5.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6514   -5.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6504   -6.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3595   -6.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0738   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9386   -6.9714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9340   -6.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4554   -4.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4652   -5.2674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1576   -4.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8706   -4.4274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5729   -4.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2859   -4.4087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5621   -3.1924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2904   -5.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9994   -5.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7041   -5.2106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6952   -4.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9816   -3.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4156   -5.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1194   -5.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8310   -5.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5348   -5.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2463   -5.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6630   -5.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3672   -5.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0783   -5.5613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7826   -5.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7757   -4.3296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  2  4  1  0
  3  5  1  0
  3  6  1  0
  3  7  1  0
  4  8  2  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 10 14  1  1
 14 15  1  0
 14 16  2  0
 12 17  1  6
 15 18  1  0
 18 19  1  1
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  2  0
 30 31  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 38 39  1  0
 37 40  1  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
 45 46  2  0
 46 41  1  0
 46 47  1  0
 45 48  1  0
 34 49  1  0
 49 50  1  0
 49 54  1  0
 50 51  1  0
 51 52  1  0
 52 53  1  0
 53 54  1  0
 52 55  1  0
 52 56  1  0
 48 57  1  0
 57 58  2  0
 57 59  1  0
 59 60  1  0
 60 61  1  0
 61 62  1  0
 61 63  2  0
 62 64  1  0
 62 68  1  0
 64 65  1  0
 65 66  1  0
 66 67  1  0
 67 68  1  0
 66 69  1  0
 69 70  1  0
 70 71  1  0
 71 72  1  0
 72 73  1  0
 73 32  1  0
 32 74  1  0
 74 75  1  0
 75 76  1  0
 76 77  1  0
 77  1  1  0
 77 78  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA4633445

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1129.94

Molecular Weight (Monoisotopic): 1128.5532

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Wang M, Lu J, Wang M, Yang CY, Wang S..  (2020)  Discovery of SHP2-D26 as a First, Potent, and Effective PROTAC Degrader of SHP2 Protein.,  63  (14): [PMID:32437146] [10.1021/acs.jmedchem.0c00471]

2. Lawrence, Harshani R and 10 more authors.  2008-08-28  Inhibitors of Src homology-2 domain containing protein tyrosine phosphatase-2 (Shp2) based on oxindole scaffolds.  [PMID:18680359]

3. Geronikaki, A A and 5 more authors.  2008-09-11  2-Thiazolylimino/heteroarylimino-5-arylidene-4-thiazolidinones as new agents with SHP-2 inhibitory action.  [PMID:18702480]

4. Dawson, Marcia I MI and 21 more authors.  2008-09-25  Adamantyl-substituted retinoid-derived molecules that interact with the orphan nuclear receptor small heterodimer partner: effects of replacing the 1-adamantyl or hydroxyl group on inhibition of cancer cell growth, induction of cancer cell apoptosis, and inhibition of SRC homology 2 domain-containing protein tyrosine phosphatase-2 activity.  [PMID:18759424]

5. He, Yantao and 6 more authors.  2013-02-14  Discovery and evaluation of novel inhibitors of mycobacterium protein tyrosine phosphatase B from the 6-Hydroxy-benzofuran-5-carboxylic acid scaffold.  [PMID:23305444]

6. He, Yantao Y and 11 more authors.  2013-06-27  A potent and selective small-molecule inhibitor for the lymphoid-specific tyrosine phosphatase (LYP), a target associated with autoimmune diseases.  [PMID:23713581]

7. Zeng, Li-Fan LF and 12 more authors.  2014-08-14  Therapeutic potential of targeting the oncogenic SHP2 phosphatase.  [PMID:25003231]

8. Tautz, Lutz L, Senis, Yotis A YA, Oury, Cécile C and Rahmouni, Souad S.  2015-06-15  Perspective: Tyrosine phosphatases as novel targets for antiplatelet therapy.  [PMID:25921264]

9. Sun, Wenlong W and 6 more authors.  2017-08-01  Varic acid analogues from fungus as PTP1B inhibitors: Biological evaluation and structure-activity relationships.  [PMID:28642102]

10. Xie, Jingjing J and 10 more authors.  2017-12-28  Allosteric Inhibitors of SHP2 with Therapeutic Potential for Cancer Treatment.  [PMID:29155585]

11. Du, Yongli Y, Zhang, Yanhui Y, Ling, Hao H, Li, Qunyi Q and Shen, Jingkang J.  2018-01-20  Discovery of novel high potent and cellular active ADC type PTP1B inhibitors with selectivity over TC-PTP via modification interacting with C site.  [PMID:29289892]

12. Kim, Bohee and 6 more authors.  2020-01-01  Development and structure-activity relationship study of SHP2 inhibitor containing 3,4,6-trihydroxy-5-oxo-5H-benzo[7]annulene.  [PMID:31784318]

13. Wang, Mingliang; Lu, Jianfeng; Wang, Mi; Yang, Chao-Yie and Wang, Shaomeng.  2020-07-23  Discovery of SHP2-D26 as a First, Potent, and Effective PROTAC Degrader of SHP2 Protein.  [PMID:32437146]

14. Yuan, Xinrui; Bu, Hong; Zhou, Jinpei; Yang, Chao-Yie and Zhang, Huibin.  2020-10-22  Recent Advances of SHP2 Inhibitors in Cancer Therapy: Current Development and Clinical Application.  [PMID:32460492]

Source

Source(1):

• Scientific Literature