N1-(3-((3-Amino-5-(4-amino-4-methylpiperidin-1-yl)pyrazin-2-yl)thio)-2-chlorophenyl)-N4-(4-((8-(((R)-1-((2R,4S)-4-hydroxy-2-(((R)-1-(4-(4-methylthiazol-5-yl)phenyl)ethyl)carbamoyl)-pyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl)amino)-8-oxooctyl)oxy)-phenyl)succinimide

ID: ALA4633507

PubChem CID: 156010992

Max Phase: Preclinical

Molecular Formula: C57H74ClN11O7S2

Molecular Weight: 1124.88

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  Cc1ncsc1-c1ccc([C@H](C)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCCCCCCOc2ccc(NC(=O)CCC(=O)Nc3cccc(Sc4ncc(N5CCC(C)(N)CC5)nc4N)c3Cl)cc2)C(C)(C)C)cc1

Standard InChI:  InChI=1S/C57H74ClN11O7S2/c1-35(37-16-18-38(19-17-37)50-36(2)62-34-77-50)63-53(74)43-31-40(70)33-69(43)55(75)51(56(3,4)5)67-46(71)15-10-8-7-9-11-30-76-41-22-20-39(21-23-41)64-47(72)24-25-48(73)65-42-13-12-14-44(49(42)58)78-54-52(59)66-45(32-61-54)68-28-26-57(6,60)27-29-68/h12-14,16-23,32,34-35,40,43,51,70H,7-11,15,24-31,33,60H2,1-6H3,(H2,59,66)(H,63,74)(H,64,72)(H,65,73)(H,67,71)/t35-,40+,43-,51+/m0/s1

Standard InChI Key:  CPTKIRPFOIQTHG-ICUABTHASA-N

Molfile:  

 
     RDKit          2D

 78 84  0  0  0  0  0  0  0  0999 V2000
   25.0907   -7.2824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8090   -6.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8187   -6.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5165   -7.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5322   -5.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1112   -5.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8254   -5.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5104   -8.1180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2336   -6.8917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9767   -7.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5312   -6.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1277   -5.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3212   -6.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3702   -7.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1871   -7.9687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9420   -8.6494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4690   -5.1606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5816   -8.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4020   -8.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1534   -9.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3310   -9.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9030  -10.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2975  -10.7879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1223  -10.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5466  -10.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8703  -11.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0544  -11.5581    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.8672  -12.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5687  -12.7862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1907  -12.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9898  -12.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1581   -3.7944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1609   -4.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8750   -5.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5868   -4.6108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5801   -3.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8654   -3.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8591   -2.5609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2884   -3.3694    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.0037   -3.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0073   -4.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7176   -4.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4269   -4.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4173   -3.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7023   -3.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6911   -2.5333    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.1242   -3.3362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4507   -5.0335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7409   -4.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0369   -5.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0359   -5.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7451   -6.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4594   -5.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3241   -6.2615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3195   -5.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8409   -3.7363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8507   -4.5575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5431   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2562   -3.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9584   -3.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6715   -3.6988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9476   -2.4825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6823   -4.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9771   -4.9295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9876   -5.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7012   -6.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4057   -5.7236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3918   -4.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7131   -6.9630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4267   -7.3613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1283   -6.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8419   -7.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5436   -6.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2572   -7.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9589   -6.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6725   -7.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3741   -6.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3622   -6.0634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  2  4  1  0
  3  5  1  0
  3  6  1  0
  3  7  1  0
  4  8  2  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 10 14  1  1
 14 15  1  0
 14 16  2  0
 12 17  1  6
 15 18  1  0
 18 19  1  1
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  2  0
 30 31  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 37 38  1  0
 36 39  1  0
 39 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 40  1  0
 45 46  1  0
 44 47  1  0
 33 48  1  0
 48 49  1  0
 48 53  1  0
 49 50  1  0
 50 51  1  0
 51 52  1  0
 52 53  1  0
 51 54  1  0
 51 55  1  0
 47 56  1  0
 56 57  2  0
 56 58  1  0
 58 59  1  0
 59 60  1  0
 60 61  1  0
 60 62  2  0
 61 63  1  0
 63 64  2  0
 64 65  1  0
 65 66  2  0
 66 67  1  0
 67 68  2  0
 68 63  1  0
 66 69  1  0
 69 70  1  0
 70 71  1  0
 71 72  1  0
 72 73  1  0
 73 74  1  0
 74 75  1  0
 75 76  1  0
 76 77  1  0
 77  1  1  0
 77 78  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA4633507

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1124.88

Molecular Weight (Monoisotopic): 1123.4903

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Wang M, Lu J, Wang M, Yang CY, Wang S..  (2020)  Discovery of SHP2-D26 as a First, Potent, and Effective PROTAC Degrader of SHP2 Protein.,  63  (14): [PMID:32437146] [10.1021/acs.jmedchem.0c00471]

2. Lawrence, Harshani R and 10 more authors.  2008-08-28  Inhibitors of Src homology-2 domain containing protein tyrosine phosphatase-2 (Shp2) based on oxindole scaffolds.  [PMID:18680359]

3. Geronikaki, A A and 5 more authors.  2008-09-11  2-Thiazolylimino/heteroarylimino-5-arylidene-4-thiazolidinones as new agents with SHP-2 inhibitory action.  [PMID:18702480]

4. Dawson, Marcia I MI and 21 more authors.  2008-09-25  Adamantyl-substituted retinoid-derived molecules that interact with the orphan nuclear receptor small heterodimer partner: effects of replacing the 1-adamantyl or hydroxyl group on inhibition of cancer cell growth, induction of cancer cell apoptosis, and inhibition of SRC homology 2 domain-containing protein tyrosine phosphatase-2 activity.  [PMID:18759424]

5. He, Yantao and 6 more authors.  2013-02-14  Discovery and evaluation of novel inhibitors of mycobacterium protein tyrosine phosphatase B from the 6-Hydroxy-benzofuran-5-carboxylic acid scaffold.  [PMID:23305444]

6. He, Yantao Y and 11 more authors.  2013-06-27  A potent and selective small-molecule inhibitor for the lymphoid-specific tyrosine phosphatase (LYP), a target associated with autoimmune diseases.  [PMID:23713581]

7. Zeng, Li-Fan LF and 12 more authors.  2014-08-14  Therapeutic potential of targeting the oncogenic SHP2 phosphatase.  [PMID:25003231]

8. Tautz, Lutz L, Senis, Yotis A YA, Oury, Cécile C and Rahmouni, Souad S.  2015-06-15  Perspective: Tyrosine phosphatases as novel targets for antiplatelet therapy.  [PMID:25921264]

9. Sun, Wenlong W and 6 more authors.  2017-08-01  Varic acid analogues from fungus as PTP1B inhibitors: Biological evaluation and structure-activity relationships.  [PMID:28642102]

10. Xie, Jingjing J and 10 more authors.  2017-12-28  Allosteric Inhibitors of SHP2 with Therapeutic Potential for Cancer Treatment.  [PMID:29155585]

11. Du, Yongli Y, Zhang, Yanhui Y, Ling, Hao H, Li, Qunyi Q and Shen, Jingkang J.  2018-01-20  Discovery of novel high potent and cellular active ADC type PTP1B inhibitors with selectivity over TC-PTP via modification interacting with C site.  [PMID:29289892]

12. Kim, Bohee and 6 more authors.  2020-01-01  Development and structure-activity relationship study of SHP2 inhibitor containing 3,4,6-trihydroxy-5-oxo-5H-benzo[7]annulene.  [PMID:31784318]

13. Wang, Mingliang; Lu, Jianfeng; Wang, Mi; Yang, Chao-Yie and Wang, Shaomeng.  2020-07-23  Discovery of SHP2-D26 as a First, Potent, and Effective PROTAC Degrader of SHP2 Protein.  [PMID:32437146]

14. Yuan, Xinrui; Bu, Hong; Zhou, Jinpei; Yang, Chao-Yie and Zhang, Huibin.  2020-10-22  Recent Advances of SHP2 Inhibitors in Cancer Therapy: Current Development and Clinical Application.  [PMID:32460492]

Source

Source(1):

• Scientific Literature