5-(2,3-dichloro-4-(N-((S)-1,1,1-trifluoropropan-2-yl)sulfamoyl)phenyl)-N-(2-hydroxy-2-methylpropyl)-4-((R)-2-methylpiperidine-1-carbonyl)thiazole-2-carboxamide

ID: ALA4633610

PubChem CID: 156010374

Max Phase: Preclinical

Molecular Formula: C24H29Cl2F3N4O5S2

Molecular Weight: 645.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1CCCCN1C(=O)c1nc(C(=O)NCC(C)(C)O)sc1-c1ccc(S(=O)(=O)N[C@@H](C)C(F)(F)F)c(Cl)c1Cl

Standard InChI:  InChI=1S/C24H29Cl2F3N4O5S2/c1-12-7-5-6-10-33(12)22(35)18-19(39-21(31-18)20(34)30-11-23(3,4)36)14-8-9-15(17(26)16(14)25)40(37,38)32-13(2)24(27,28)29/h8-9,12-13,32,36H,5-7,10-11H2,1-4H3,(H,30,34)/t12-,13+/m1/s1

Standard InChI Key:  UTZQQYRSTGZNIH-OLZOCXBDSA-N

Molfile:  

 
     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
    5.2498   -7.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3442   -3.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9397   -3.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5267   -3.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6850   -2.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3572   -3.2480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0998   -2.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7762   -3.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5514   -3.0922    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.0456   -3.7456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8667   -3.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2924   -4.4287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1156   -4.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5112   -3.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3316   -3.6544    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.0130   -3.1960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2768   -2.8366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7665   -4.3473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5873   -4.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0259   -5.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9735   -3.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0776   -2.9827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2601   -3.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8346   -2.3016    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.4704   -2.2597    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.5823   -4.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7953   -4.1841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8553   -5.1967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3248   -5.8182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5179   -5.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9841   -6.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0615   -7.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6006   -6.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6630   -5.3454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1662   -2.0796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2660   -2.6683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6469   -5.7331    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.8424   -4.9753    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.4271   -5.7121    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.2470   -4.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  5  3  1  0
  6  5  1  0
  7  6  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 17 15  2  0
 15 18  1  0
 18 19  1  0
 19 20  1  1
 19 21  1  0
 14 22  2  0
 23 22  1  0
 23 11  2  0
 23 24  1  0
 22 25  1  0
 26 10  2  0
 27 26  1  0
  8 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31  1  1  0
  1 32  1  0
 32 33  1  0
 29 33  1  0
 28 34  2  0
  7 35  2  0
  3 36  1  0
 20 37  1  0
 20 38  1  0
 20 39  1  0
 30 40  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4633610

    ---

Associated Targets(Human)

RORB Tchem Nuclear receptor ROR-beta (600 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 645.55Molecular Weight (Monoisotopic): 644.0909AlogP: 4.86#Rotatable Bonds: 8
Polar Surface Area: 128.70Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.69CX Basic pKa: CX LogP: 4.10CX LogD: 3.51
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.38Np Likeness Score: -1.11

References

1. Gege C, Albers M, Kinzel O, Kleymann G, Schlüter T, Steeneck C, Hoffmann T, Xue X, Cummings MD, Spurlino J, Milligan C, Fourie AM, Edwards JP, Leonard K, Coe K, Scott B, Pippel D, Goldberg SD..  (2020)  Optimization and biological evaluation of thiazole-bis-amide inverse agonists of RORγt.,  30  (12): [PMID:32336498] [10.1016/j.bmcl.2020.127205]

Source