The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2,3-dichloro-4-(N-((S)-1,1,1-trifluoropropan-2-yl)sulfamoyl)phenyl)-N-(2-hydroxy-2-methylpropyl)-4-((R)-2-methylpiperidine-1-carbonyl)thiazole-2-carboxamide ID: ALA4633610
PubChem CID: 156010374
Max Phase: Preclinical
Molecular Formula: C24H29Cl2F3N4O5S2
Molecular Weight: 645.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CCCCN1C(=O)c1nc(C(=O)NCC(C)(C)O)sc1-c1ccc(S(=O)(=O)N[C@@H](C)C(F)(F)F)c(Cl)c1Cl
Standard InChI: InChI=1S/C24H29Cl2F3N4O5S2/c1-12-7-5-6-10-33(12)22(35)18-19(39-21(31-18)20(34)30-11-23(3,4)36)14-8-9-15(17(26)16(14)25)40(37,38)32-13(2)24(27,28)29/h8-9,12-13,32,36H,5-7,10-11H2,1-4H3,(H,30,34)/t12-,13+/m1/s1
Standard InChI Key: UTZQQYRSTGZNIH-OLZOCXBDSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
5.2498 -7.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3442 -3.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9397 -3.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5267 -3.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6850 -2.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3572 -3.2480 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0998 -2.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7762 -3.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5514 -3.0922 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.0456 -3.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8667 -3.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2924 -4.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1156 -4.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5112 -3.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3316 -3.6544 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.0130 -3.1960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2768 -2.8366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7665 -4.3473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5873 -4.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0259 -5.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9735 -3.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0776 -2.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2601 -3.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8346 -2.3016 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.4704 -2.2597 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.5823 -4.4223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7953 -4.1841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8553 -5.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3248 -5.8182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5179 -5.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9841 -6.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0615 -7.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6006 -6.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6630 -5.3454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1662 -2.0796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2660 -2.6683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6469 -5.7331 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8424 -4.9753 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.4271 -5.7121 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2470 -4.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
5 3 1 0
6 5 1 0
7 6 1 0
8 7 1 0
9 8 1 0
10 9 1 0
11 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
17 15 2 0
15 18 1 0
18 19 1 0
19 20 1 1
19 21 1 0
14 22 2 0
23 22 1 0
23 11 2 0
23 24 1 0
22 25 1 0
26 10 2 0
27 26 1 0
8 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 1 1 0
1 32 1 0
32 33 1 0
29 33 1 0
28 34 2 0
7 35 2 0
3 36 1 0
20 37 1 0
20 38 1 0
20 39 1 0
30 40 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 645.55Molecular Weight (Monoisotopic): 644.0909AlogP: 4.86#Rotatable Bonds: 8Polar Surface Area: 128.70Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.69CX Basic pKa: ┄CX LogP: 4.10CX LogD: 3.51Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.38Np Likeness Score: -1.11
References 1. Gege C, Albers M, Kinzel O, Kleymann G, Schlüter T, Steeneck C, Hoffmann T, Xue X, Cummings MD, Spurlino J, Milligan C, Fourie AM, Edwards JP, Leonard K, Coe K, Scott B, Pippel D, Goldberg SD.. (2020) Optimization and biological evaluation of thiazole-bis-amide inverse agonists of RORγt., 30 (12): [PMID:32336498 ] [10.1016/j.bmcl.2020.127205 ]