The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-beta-Fluoro-2'-deoxyzebularine-5'-[Phenyl(methoxy-L-alaninyl)]phosphate ID: ALA463391
PubChem CID: 25155321
Max Phase: Preclinical
Molecular Formula: C19H23FN3O8P
Molecular Weight: 471.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cccnc2=O)[C@@H](F)[C@@H]1O)Oc1ccccc1
Standard InChI: InChI=1S/C19H23FN3O8P/c1-12(18(25)28-2)22-32(27,31-13-7-4-3-5-8-13)29-11-14-16(24)15(20)17(30-14)23-10-6-9-21-19(23)26/h3-10,12,14-17,24H,11H2,1-2H3,(H,22,27)/t12-,14+,15-,16+,17+,32?/m0/s1
Standard InChI Key: LXWLBMJUHGIEPQ-BORMQNQCSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
12.7188 -1.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5438 -1.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7988 -0.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1313 0.2521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4639 -0.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2338 -1.6850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5834 0.0220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1960 -0.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9779 -0.2855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1537 0.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5412 1.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7529 0.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0208 -1.3435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6793 0.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5077 0.8290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7230 1.0839 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
9.9229 1.3016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9589 1.8745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4915 0.2921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3373 0.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5443 0.9403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9590 0.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1692 -0.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9701 -0.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5520 -0.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7616 2.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9974 2.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3283 1.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7988 3.0477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4295 3.4562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3661 2.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0287 -1.6850 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7 8 1 0
15 16 1 0
2 3 1 0
16 17 1 0
3 4 1 0
16 18 1 0
4 5 1 0
16 19 2 0
5 1 1 0
17 20 1 0
1 2 1 0
20 21 2 0
7 12 1 0
21 22 1 0
8 9 1 0
22 23 2 0
9 10 2 0
23 24 1 0
10 11 1 0
24 25 2 0
25 20 1 0
11 12 2 0
18 26 1 0
1 6 1 6
26 27 1 0
8 13 2 0
26 28 1 6
5 14 1 1
27 29 1 0
27 30 2 0
3 7 1 1
29 31 1 0
14 15 1 0
2 32 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.38Molecular Weight (Monoisotopic): 471.1207AlogP: 1.19#Rotatable Bonds: 9Polar Surface Area: 138.21Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.24CX Basic pKa: ┄CX LogP: 0.44CX LogD: 0.44Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: 0.10
References 1. Yoo CB, Valente R, Congiatu C, Gavazza F, Angel A, Siddiqui MA, Jones PA, McGuigan C, Marquez VE.. (2008) Activation of p16 gene silenced by DNA methylation in cancer cells by phosphoramidate derivatives of 2'-deoxyzebularine., 51 (23): [PMID:19006382 ] [10.1021/jm8005965 ]