The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(8-ethoxy-2-oxo-2H-chromen-3-yl)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA4634257
PubChem CID: 142770779
Max Phase: Preclinical
Molecular Formula: C23H18FNO6
Molecular Weight: 423.40
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cccc2cc(-c3cc4c(cc3F)c(=O)c(C(=O)O)cn4CC)c(=O)oc12
Standard InChI: InChI=1S/C23H18FNO6/c1-3-25-11-16(22(27)28)20(26)15-9-17(24)13(10-18(15)25)14-8-12-6-5-7-19(30-4-2)21(12)31-23(14)29/h5-11H,3-4H2,1-2H3,(H,27,28)
Standard InChI Key: LJCCDSXAZBHQFG-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
33.4002 -23.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3991 -24.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1071 -24.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1054 -23.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8140 -23.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8128 -24.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5229 -24.8984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2387 -24.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2399 -23.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5253 -23.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5253 -22.4308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9486 -23.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9506 -22.4399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6924 -23.2571 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.5206 -25.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6553 -23.6674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2271 -26.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6946 -24.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9874 -24.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9838 -26.1129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6959 -25.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2766 -25.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2852 -24.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5850 -24.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8758 -24.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8711 -25.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5719 -26.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4029 -26.1166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5669 -26.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8567 -27.3230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8516 -28.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
9 12 1 0
12 13 2 0
1 14 1 0
7 15 1 0
12 16 1 0
15 17 1 0
18 19 2 0
18 21 1 0
19 23 1 0
22 20 1 0
20 21 1 0
2 18 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.40Molecular Weight (Monoisotopic): 423.1118AlogP: 4.03#Rotatable Bonds: 5Polar Surface Area: 98.74Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.55CX Basic pKa: ┄CX LogP: 3.55CX LogD: 1.70Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -0.66
References 1. Suaifan GARY, Mohammed AAM.. (2019) Fluoroquinolones structural and medicinal developments (2013-2018): Where are we now?, 27 (14): [PMID:31182257 ] [10.1016/j.bmc.2019.05.038 ]