(+)-cis-Methylkellactone

ID: ALA463444

Cas Number: 20107-13-5

PubChem CID: 44567006

Max Phase: Preclinical

Molecular Formula: C15H16O5

Molecular Weight: 276.29

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: (+)-Cis-Methylkellactone | cis-Methylkhellactone|20107-13-5|(+)-cis-Methylkellactone|CHEMBL463444|AKOS040761511|(9R,10R)-9-hydroxy-10-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one

Canonical SMILES:  CO[C@@H]1c2c(ccc3ccc(=O)oc23)OC(C)(C)[C@@H]1O

Standard InChI:  InChI=1S/C15H16O5/c1-15(2)14(17)13(18-3)11-9(20-15)6-4-8-5-7-10(16)19-12(8)11/h4-7,13-14,17H,1-3H3/t13-,14-/m1/s1

Standard InChI Key:  MDDPVXHWOABQJQ-ZIAGYGMSSA-N

Molfile:  

     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   -3.6707  -12.8389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6707  -13.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9585  -14.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2464  -13.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9585  -12.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2459  -12.8380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2401  -11.1920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9587  -11.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5315  -11.6055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5416  -12.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8330  -12.8555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1101  -12.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1000  -11.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8130  -11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5989  -12.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3873  -13.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6660  -14.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9585  -14.8938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5368  -14.0747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5382  -14.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  1  0
  4  6  1  0
  5  6  2  0
  1  2  1  0
  1  5  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
  2  3  1  0
 12 15  2  0
  5  8  1  0
  2 16  1  0
  6 10  1  0
  2 17  1  0
  9  7  1  0
  3 18  1  1
  7  8  2  0
  4 19  1  1
  9 10  2  0
 19 20  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Amaranthus hypochondriacus (68 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Echinochloa crus-galli (3685 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CALM Calmodulin (71 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Calmodulin (30 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 276.29Molecular Weight (Monoisotopic): 276.0998AlogP: 2.01#Rotatable Bonds: 1
Polar Surface Area: 68.90Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.85CX Basic pKa: CX LogP: 1.46CX LogD: 1.46
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.81Np Likeness Score: 2.31

References

1. Valencia-Islas N, Abbas H, Bye R, Toscano R, Mata R..  (2002)  Phytotoxic compounds from Prionosciadium watsoni.,  65  (6): [PMID:12088423] [10.1021/np010448t]

Source