The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Rhodocorane L ID: ALA4634495
PubChem CID: 156009674
Max Phase: Preclinical
Molecular Formula: C15H20O4
Molecular Weight: 264.32
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(O)C(=O)[C@]23C(=O)[C@H]1[C@H](O)[C@@H](C)[C@H]2CC[C@H]3C
Standard InChI: InChI=1S/C15H20O4/c1-6-4-5-9-7(2)11(16)10-8(3)12(17)14(19)15(6,9)13(10)18/h6-7,9-11,16-17H,4-5H2,1-3H3/t6-,7+,9-,10-,11-,15+/m1/s1
Standard InChI Key: PSRWXKPUAGZVKZ-CNQZAIAMSA-N
Molfile:
RDKit 2D
21 23 0 0 0 0 0 0 0 0999 V2000
10.4132 -12.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7033 -12.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0953 -12.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4295 -13.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2439 -13.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4171 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1224 -13.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8277 -12.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8277 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1224 -11.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6990 -11.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4045 -11.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9891 -11.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4014 -10.2400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1146 -10.6524 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.5366 -11.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1224 -13.9211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5348 -13.1091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9932 -11.8782 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.4543 -14.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0044 -11.1724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 1 1 0
6 10 1 0
1 7 1 1
7 8 1 0
8 9 2 0
9 10 1 0
2 11 1 0
10 12 1 0
11 12 1 0
11 13 1 6
12 14 1 1
10 15 1 6
9 16 1 0
7 17 2 0
8 18 1 0
2 19 1 1
5 20 1 6
6 21 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 264.32Molecular Weight (Monoisotopic): 264.1362AlogP: 1.63#Rotatable Bonds: ┄Polar Surface Area: 74.60Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.81CX Basic pKa: ┄CX LogP: 1.86CX LogD: 1.84Aromatic Rings: ┄Heavy Atoms: 19QED Weighted: 0.65Np Likeness Score: 1.76
References 1. Sandargo B, Michehl M, Stadler M, Surup F.. (2020) Antifungal Sesquiterpenoids, Rhodocoranes, from Submerged Cultures of the Wrinkled Peach Mushroom, Rhodotus palmatus., 83 (3): [PMID:31820970 ] [10.1021/acs.jnatprod.9b00871 ]