The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
thorectandrol C ID: ALA463450
PubChem CID: 636729
Max Phase: Preclinical
Molecular Formula: C27H40O5
Molecular Weight: 444.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Thorectandrol C | CHEMBL463450
Canonical SMILES: C=C1CCC[C@H]2[C@](C)(CC/C(C)=C/C[C@@H](O)C3=CC(=O)OC3)[C@@H](C)[C@H](OC(C)=O)C[C@]12C
Standard InChI: InChI=1S/C27H40O5/c1-17(10-11-22(29)21-14-25(30)31-16-21)12-13-26(5)19(3)23(32-20(4)28)15-27(6)18(2)8-7-9-24(26)27/h10,14,19,22-24,29H,2,7-9,11-13,15-16H2,1,3-6H3/b17-10+/t19-,22+,23+,24-,26+,27+/m0/s1
Standard InChI Key: DHZHHHTYJVQJEJ-VIYFSLSRSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
4.5083 -9.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5083 -10.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2204 -10.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2204 -8.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9324 -9.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9334 -10.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6445 -10.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3590 -10.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3580 -9.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6424 -8.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9292 -10.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9250 -8.3625 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2250 -8.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0500 -8.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8750 -8.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2824 -7.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1074 -7.3252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8649 -6.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5149 -6.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2201 -11.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0723 -8.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0735 -10.4233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0734 -11.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7878 -11.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3589 -11.6607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3399 -6.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7471 -5.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7574 -7.3136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5702 -5.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8446 -5.1259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1894 -4.6244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5102 -5.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6354 -4.8906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
5 4 1 0
16 17 2 0
5 10 1 0
16 18 1 0
6 7 1 0
17 19 1 0
7 8 1 0
3 20 2 0
8 9 1 0
9 21 1 1
9 10 1 0
8 22 1 6
5 6 1 0
22 23 1 0
6 11 1 1
23 24 1 0
23 25 2 0
5 12 1 6
19 26 1 0
1 2 1 0
26 27 1 0
10 13 1 1
26 28 1 6
27 29 2 0
1 4 1 0
10 14 1 0
2 3 1 0
14 15 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 27 1 0
3 6 1 0
30 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.61Molecular Weight (Monoisotopic): 444.2876AlogP: 5.29#Rotatable Bonds: 7Polar Surface Area: 72.83Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.73CX Basic pKa: ┄CX LogP: 4.66CX LogD: 3.00Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: 3.46
References 1. Charan RD, McKee TC, Boyd MR.. (2002) Thorectandrols C, D, and E, new sesterterpenes from the marine sponge Thorectandra sp., 65 (4): [PMID:11975486 ] [10.1021/np010439k ]