The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[3-[4-(2-chlorophenyl)-5-pyrimidin-2-yl-1,2,4-triazol-3-yl]cyclobutyl]-2-oxo-3H-benzimidazole-5-carbonitrile ID: ALA4634574
PubChem CID: 156009696
Max Phase: Preclinical
Molecular Formula: C24H17ClN8O
Molecular Weight: 468.91
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc2c(c1)[nH]c(=O)n2[C@H]1C[C@H](c2nnc(-c3ncccn3)n2-c2ccccc2Cl)C1
Standard InChI: InChI=1S/C24H17ClN8O/c25-17-4-1-2-5-19(17)33-22(30-31-23(33)21-27-8-3-9-28-21)15-11-16(12-15)32-20-7-6-14(13-26)10-18(20)29-24(32)34/h1-10,15-16H,11-12H2,(H,29,34)/t15-,16-
Standard InChI Key: QNPJJFUGIXURAN-WKILWMFISA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
35.4831 -6.8323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8167 -6.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0686 -5.5636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8935 -5.5636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1495 -6.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9469 -6.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6731 -6.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0837 -6.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3575 -7.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8811 -7.0673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5221 -6.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2148 -7.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9973 -7.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1743 -7.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7997 -8.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2555 -9.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0724 -9.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4492 -8.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4871 -9.9347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8976 -10.6477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5221 -5.7254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0193 -6.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8054 -7.3585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0112 -7.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4271 -6.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6369 -6.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4318 -5.9736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4831 -7.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1960 -8.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1949 -8.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4816 -9.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7685 -8.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7657 -8.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9089 -7.6577 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
6 5 1 6
7 6 1 0
8 7 1 0
8 9 1 0
9 6 1 0
8 10 1 1
11 10 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
13 18 1 0
19 17 1 0
19 20 3 0
11 21 2 0
22 2 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
28 1 1 0
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
29 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.91Molecular Weight (Monoisotopic): 468.1214AlogP: 4.01#Rotatable Bonds: 4Polar Surface Area: 118.07Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.73CX Basic pKa: 0.33CX LogP: 3.92CX LogD: 3.92Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -1.58
References 1. Waaler J, Leenders RGG, Sowa ST, Alam Brinch S, Lycke M, Nieczypor P, Aertssen S, Murthy S, Galera-Prat A, Damen E, Wegert A, Nazaré M, Lehtiö L, Krauss S.. (2020) Preclinical Lead Optimization of a 1,2,4-Triazole Based Tankyrase Inhibitor., 63 (13): [PMID:32511917 ] [10.1021/acs.jmedchem.0c00208 ]