The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[2,6-difluoro-4-[3-[1-(4-piperidyl)pyrazol-4-yl]quinoxalin-5-yl]phenyl]methyl]morpholine dihydrochloride ID: ALA4634656
Cas Number: 1942919-79-0
PubChem CID: 57339395
Product Number: N412792, Order Now?
Max Phase: Preclinical
Molecular Formula: C27H30Cl2F2N6O
Molecular Weight: 490.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.Fc1cc(-c2cccc3ncc(-c4cnn(C5CCNCC5)c4)nc23)cc(F)c1CN1CCOCC1
Standard InChI: InChI=1S/C27H28F2N6O.2ClH/c28-23-12-18(13-24(29)22(23)17-34-8-10-36-11-9-34)21-2-1-3-25-27(21)33-26(15-31-25)19-14-32-35(16-19)20-4-6-30-7-5-20;;/h1-3,12-16,20,30H,4-11,17H2;2*1H
Standard InChI Key: NUOCAPALWRHKCU-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
36.7125 -12.3750 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.2977 -14.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2965 -15.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0113 -15.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0095 -13.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7248 -14.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7255 -15.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4409 -15.5669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1558 -15.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1511 -14.3223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4352 -13.9151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0041 -13.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7190 -12.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7169 -11.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0007 -11.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2852 -11.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2907 -12.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8630 -13.9055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6178 -14.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1661 -13.6176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7493 -12.9055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9434 -13.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9848 -13.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3236 -14.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1407 -14.5319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6253 -13.8637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2865 -13.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4633 -13.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9971 -10.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2809 -10.2143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2774 -9.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5682 -10.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8520 -10.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5611 -8.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8485 -9.3954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4303 -11.4455 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.5680 -11.4598 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.1214 -11.9625 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
5 12 1 0
10 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 18 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
20 23 1 0
15 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
32 33 1 0
31 34 1 0
33 35 1 0
35 34 1 0
14 36 1 0
16 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.56Molecular Weight (Monoisotopic): 490.2293AlogP: 4.20#Rotatable Bonds: 5Polar Surface Area: 68.10Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.12CX LogP: 3.06CX LogD: 0.45Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: -1.32
References 1. Zhao J, Cui R, Wang L, Chen Y, Fu Z, Ding X, Cui C, Yang T, Li X, Xu Y, Chen K, Luo X, Jiang H, Zheng M.. (2020) Revisiting Aldehyde Oxidase Mediated Metabolism in Drug-like Molecules: An Improved Computational Model., 63 (12): [PMID:32191458 ] [10.1021/acs.jmedchem.9b01895 ]