The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((2S,4R)-2-(5-(1,4-dimethyl-1H-imidazol-5-yl)-4H-1,2,4-triazol-3-yl)tetrahydro-2H-pyran-4-yl)-N-methyl-3-(trifluoromethoxy)benzamide ID: ALA4634933
PubChem CID: 135218990
Max Phase: Preclinical
Molecular Formula: C21H23F3N6O3
Molecular Weight: 464.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncn(C)c1-c1nnc([C@@H]2C[C@H](N(C)C(=O)c3cccc(OC(F)(F)F)c3)CCO2)[nH]1
Standard InChI: InChI=1S/C21H23F3N6O3/c1-12-17(29(2)11-25-12)19-26-18(27-28-19)16-10-14(7-8-32-16)30(3)20(31)13-5-4-6-15(9-13)33-21(22,23)24/h4-6,9,11,14,16H,7-8,10H2,1-3H3,(H,26,27,28)/t14-,16+/m1/s1
Standard InChI Key: QNCLPVUZVLXOPW-ZBFHGGJFSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
14.4852 -9.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4840 -10.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1921 -11.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9017 -10.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8989 -9.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1903 -9.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6051 -9.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3143 -9.9211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6020 -8.6980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3174 -10.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0205 -9.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7322 -9.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4363 -9.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4374 -8.6954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7283 -8.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0181 -8.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1440 -9.9216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2287 -10.7309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0281 -10.9008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4367 -10.1930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8898 -9.5859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2499 -10.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7302 -10.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5027 -10.5922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4998 -9.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7255 -9.5306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4805 -11.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7204 -8.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1919 -11.9758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4840 -12.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4838 -13.2014 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7764 -11.9754 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7726 -12.7862 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
11 8 1 6
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
13 17 1 6
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 1 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 22 1 0
23 27 1 0
26 28 1 0
3 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.45Molecular Weight (Monoisotopic): 464.1784AlogP: 3.40#Rotatable Bonds: 5Polar Surface Area: 98.16Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.33CX Basic pKa: 5.06CX LogP: 1.78CX LogD: 1.71Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.62Np Likeness Score: -0.99
References 1. Liu LZ, Ma T, Zhou J, Long Hu Z, Jun Zhang X, Zhen Zhang H, Zeng M, Liu J, Li L, Jiang Y, Zou Z, Wang F, Zhang L, Xu J, Wang J, Xiao F, Fang X, Zou H, Efanov AM, Thomas MK, Lin HV, Chen J.. (2020) Discovery of LY3325656: A GPR142 agonist suitable for clinical testing in human., 30 (5): [PMID:31982234 ] [10.1016/j.bmcl.2019.126857 ] 2. (2019) Tetrahydropyranyl benzamide derivatives,