(2R,4S)-1-((R)-2-(9-(4-(4-((3-((3-Amino-5-(4-amino-4-methylpiperidin-1-yl)pyrazin-2-yl)thio)-2-chlorophenyl)amino)-4-oxobutanoyl)piperazin-1-yl)nonanamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-((R)-1-(4-(4-methylthiazol-5-yl)phenyl)ethyl)-pyrrolidine-2-carboxamide

ID: ALA4635440

PubChem CID: 155930583

Max Phase: Preclinical

Molecular Formula: C56H79ClN12O6S2

Molecular Weight: 1115.91

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  Cc1ncsc1-c1ccc([C@H](C)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCCCCCCCN2CCN(C(=O)CCC(=O)Nc3cccc(Sc4ncc(N5CCC(C)(N)CC5)nc4N)c3Cl)CC2)C(C)(C)C)cc1

Standard InChI:  InChI=1S/C56H79ClN12O6S2/c1-36(38-17-19-39(20-18-38)49-37(2)61-35-76-49)62-52(74)42-32-40(70)34-69(42)54(75)50(55(3,4)5)65-45(71)16-11-9-7-8-10-12-25-66-28-30-68(31-29-66)47(73)22-21-46(72)63-41-14-13-15-43(48(41)57)77-53-51(58)64-44(33-60-53)67-26-23-56(6,59)24-27-67/h13-15,17-20,33,35-36,40,42,50,70H,7-12,16,21-32,34,59H2,1-6H3,(H2,58,64)(H,62,74)(H,63,72)(H,65,71)/t36-,40+,42-,50+/m0/s1

Standard InChI Key:  XJSPAQRZSJUBLB-WQFCSRJTSA-N

Molfile:  

 
     RDKit          2D

 77 83  0  0  0  0  0  0  0  0999 V2000
   24.4758   -5.0193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2055   -5.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8999   -4.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2393   -6.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6280   -5.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8661   -4.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5948   -4.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5451   -6.6651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9675   -6.6065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0865   -7.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8963   -7.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2794   -6.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7037   -6.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6974   -8.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1240   -8.8318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8763   -8.1559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0920   -6.7039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7338   -9.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1606  -10.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9128   -9.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4849   -8.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6646   -8.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2736   -9.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7048  -10.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5237  -10.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4526   -9.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9518   -8.9901    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.1777   -9.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1999  -10.0888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9878  -10.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2630  -11.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6464   -5.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4672   -4.3804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4699   -5.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1840   -5.6138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8958   -5.1969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8891   -4.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1745   -3.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1682   -3.1469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5975   -3.9555    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.3127   -4.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3164   -5.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0267   -5.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7360   -5.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7264   -4.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0114   -3.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0002   -3.1194    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.4332   -3.9223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7597   -5.6196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0499   -5.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3459   -5.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3450   -6.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0541   -6.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7684   -6.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6332   -6.8476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6285   -6.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1499   -4.3223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1598   -5.1436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8522   -3.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5652   -4.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2675   -3.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9805   -4.2849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2567   -3.0686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9850   -5.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6940   -5.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3987   -5.0868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3898   -4.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6762   -3.8651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1102   -5.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8140   -5.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5255   -5.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2294   -5.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9409   -5.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3575   -5.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0618   -5.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7729   -5.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7798   -6.2546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  2  4  1  0
  3  5  1  0
  3  6  1  0
  3  7  1  0
  4  8  2  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 10 14  1  1
 14 15  1  0
 14 16  2  0
 12 17  1  6
 15 18  1  0
 18 19  1  1
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  2  0
 30 31  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 38 39  1  0
 37 40  1  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
 45 46  2  0
 46 41  1  0
 46 47  1  0
 45 48  1  0
 34 49  1  0
 49 50  1  0
 49 54  1  0
 50 51  1  0
 51 52  1  0
 52 53  1  0
 53 54  1  0
 52 55  1  0
 52 56  1  0
 48 57  1  0
 57 58  2  0
 57 59  1  0
 59 60  1  0
 60 61  1  0
 61 62  1  0
 61 63  2  0
 62 64  1  0
 62 68  1  0
 64 65  1  0
 65 66  1  0
 66 67  1  0
 67 68  1  0
 66 69  1  0
 69 70  1  0
 70 71  1  0
 71 72  1  0
 72 73  1  0
 73 32  1  0
 32 74  1  0
 74 75  1  0
 75 76  1  0
 76  1  1  0
 76 77  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA4635440

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1115.91

Molecular Weight (Monoisotopic): 1114.5375

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Wang M, Lu J, Wang M, Yang CY, Wang S..  (2020)  Discovery of SHP2-D26 as a First, Potent, and Effective PROTAC Degrader of SHP2 Protein.,  63  (14): [PMID:32437146] [10.1021/acs.jmedchem.0c00471]

2. Lawrence, Harshani R and 10 more authors.  2008-08-28  Inhibitors of Src homology-2 domain containing protein tyrosine phosphatase-2 (Shp2) based on oxindole scaffolds.  [PMID:18680359]

3. Geronikaki, A A and 5 more authors.  2008-09-11  2-Thiazolylimino/heteroarylimino-5-arylidene-4-thiazolidinones as new agents with SHP-2 inhibitory action.  [PMID:18702480]

4. Dawson, Marcia I MI and 21 more authors.  2008-09-25  Adamantyl-substituted retinoid-derived molecules that interact with the orphan nuclear receptor small heterodimer partner: effects of replacing the 1-adamantyl or hydroxyl group on inhibition of cancer cell growth, induction of cancer cell apoptosis, and inhibition of SRC homology 2 domain-containing protein tyrosine phosphatase-2 activity.  [PMID:18759424]

5. He, Yantao and 6 more authors.  2013-02-14  Discovery and evaluation of novel inhibitors of mycobacterium protein tyrosine phosphatase B from the 6-Hydroxy-benzofuran-5-carboxylic acid scaffold.  [PMID:23305444]

6. He, Yantao Y and 11 more authors.  2013-06-27  A potent and selective small-molecule inhibitor for the lymphoid-specific tyrosine phosphatase (LYP), a target associated with autoimmune diseases.  [PMID:23713581]

7. Zeng, Li-Fan LF and 12 more authors.  2014-08-14  Therapeutic potential of targeting the oncogenic SHP2 phosphatase.  [PMID:25003231]

8. Tautz, Lutz L, Senis, Yotis A YA, Oury, Cécile C and Rahmouni, Souad S.  2015-06-15  Perspective: Tyrosine phosphatases as novel targets for antiplatelet therapy.  [PMID:25921264]

9. Sun, Wenlong W and 6 more authors.  2017-08-01  Varic acid analogues from fungus as PTP1B inhibitors: Biological evaluation and structure-activity relationships.  [PMID:28642102]

10. Xie, Jingjing J and 10 more authors.  2017-12-28  Allosteric Inhibitors of SHP2 with Therapeutic Potential for Cancer Treatment.  [PMID:29155585]

11. Du, Yongli Y, Zhang, Yanhui Y, Ling, Hao H, Li, Qunyi Q and Shen, Jingkang J.  2018-01-20  Discovery of novel high potent and cellular active ADC type PTP1B inhibitors with selectivity over TC-PTP via modification interacting with C site.  [PMID:29289892]

12. Kim, Bohee and 6 more authors.  2020-01-01  Development and structure-activity relationship study of SHP2 inhibitor containing 3,4,6-trihydroxy-5-oxo-5H-benzo[7]annulene.  [PMID:31784318]

13. Wang, Mingliang; Lu, Jianfeng; Wang, Mi; Yang, Chao-Yie and Wang, Shaomeng.  2020-07-23  Discovery of SHP2-D26 as a First, Potent, and Effective PROTAC Degrader of SHP2 Protein.  [PMID:32437146]

14. Yuan, Xinrui; Bu, Hong; Zhou, Jinpei; Yang, Chao-Yie and Zhang, Huibin.  2020-10-22  Recent Advances of SHP2 Inhibitors in Cancer Therapy: Current Development and Clinical Application.  [PMID:32460492]

Source

Source(1):

• Scientific Literature