The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pentyl ((5S)-5-(((4-aminopyrimidin-2-yl)oxy)methyl)-2-oxido-1,4,2-dioxaphosphinan-2-yl)-L-valinate ID: ALA4635841
PubChem CID: 156014501
Max Phase: Preclinical
Molecular Formula: C18H31N4O6P
Molecular Weight: 430.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCOC(=O)[C@@H](NP1(=O)CO[C@@H](COc2nccc(N)n2)CO1)C(C)C
Standard InChI: InChI=1S/C18H31N4O6P/c1-4-5-6-9-25-17(23)16(13(2)3)22-29(24)12-27-14(11-28-29)10-26-18-20-8-7-15(19)21-18/h7-8,13-14,16H,4-6,9-12H2,1-3H3,(H,22,24)(H2,19,20,21)/t14-,16-,29?/m0/s1
Standard InChI Key: ANBLXARAOKNPIH-SFTPBGRASA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
17.3067 -3.5291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3055 -4.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0203 -4.7693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7368 -4.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7339 -3.5254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0185 -3.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0161 -2.2914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4518 -4.7674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4532 -5.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1682 -6.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1655 -6.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8765 -7.2368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5928 -6.8267 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
21.5935 -6.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8779 -5.5849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3063 -7.2407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5872 -7.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0217 -6.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7352 -7.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4506 -6.8330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7334 -8.0689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1641 -7.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8795 -6.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5930 -7.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3084 -6.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0220 -7.2534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0235 -6.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7389 -5.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3100 -5.5907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
4 8 1 0
8 9 1 0
10 9 1 6
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
13 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
18 27 1 1
27 28 1 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.44Molecular Weight (Monoisotopic): 430.1981AlogP: 2.35#Rotatable Bonds: 11Polar Surface Area: 134.89Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.51CX Basic pKa: 5.84CX LogP: 2.08CX LogD: 2.07Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.31Np Likeness Score: -0.12
References 1. Luo M, Groaz E, Snoeck R, Andrei G, Herdewijn P.. (2020) Amidate Prodrugs of O -2-Alkylated Pyrimidine Acyclic Nucleosides Display Potent Anti-Herpesvirus Activity., 11 (7): [PMID:32676147 ] [10.1021/acsmedchemlett.0c00090 ]