The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-cyclobutyl-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methyl-pyrimido[4,5-b][1,4]benzodiazepin-6-one ID: ALA4636072
PubChem CID: 156014306
Max Phase: Preclinical
Molecular Formula: C28H33N7O2
Molecular Weight: 499.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2c(n1)N(C1CCC1)c1ccccc1C(=O)N2C
Standard InChI: InChI=1S/C28H33N7O2/c1-32-13-15-34(16-14-32)20-11-12-22(25(17-20)37-3)30-28-29-18-24-26(31-28)35(19-7-6-8-19)23-10-5-4-9-21(23)27(36)33(24)2/h4-5,9-12,17-19H,6-8,13-16H2,1-3H3,(H,29,30,31)
Standard InChI Key: NGSRRJBACKDZHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
43.2958 -9.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4978 -9.7707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9137 -10.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1199 -10.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9062 -9.3433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.4863 -8.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2842 -8.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1083 -9.1296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5299 -9.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7308 -9.5044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5158 -8.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1004 -8.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8867 -7.3239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4709 -6.7396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8946 -8.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7179 -8.4880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5042 -7.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7003 -7.5604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4113 -6.7928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9319 -6.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7400 -6.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0233 -7.0664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7565 -5.3598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3407 -4.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0145 -4.9911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0145 -4.1696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2722 -5.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6699 -4.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8824 -5.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6904 -5.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2892 -6.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0803 -6.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5902 -6.7928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1753 -7.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3942 -8.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5960 -8.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3772 -7.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
7 6 1 0
2 7 1 0
8 5 1 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
12 13 1 0
13 14 1 0
15 12 1 0
8 15 2 0
16 11 1 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
20 21 1 0
22 21 2 0
17 22 1 0
23 20 1 0
23 24 1 0
25 23 1 0
25 26 2 0
27 25 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
32 31 1 0
27 32 2 0
32 33 1 0
33 19 1 0
33 34 1 0
35 34 1 0
36 35 1 0
36 37 1 0
37 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.62Molecular Weight (Monoisotopic): 499.2696AlogP: 4.26#Rotatable Bonds: 5Polar Surface Area: 77.07Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.84CX LogP: 4.12CX LogD: 3.54Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.56Np Likeness Score: -1.12
References 1. Ferguson FM, Liu Y, Harshbarger W, Huang L, Wang J, Deng X, Capuzzi SJ, Muratov EN, Tropsha A, Muthuswamy S, Westover KD, Gray NS.. (2020) Synthesis and Structure-Activity Relationships of DCLK1 Kinase Inhibitors Based on a 5,11-Dihydro-6H -benzo[e ]pyrimido[5,4-b ][1,4]diazepin-6-one Scaffold., 63 (14): [PMID:32530623 ] [10.1021/acs.jmedchem.0c00596 ]