3-chloro-N-((2S,4R)-2-(5-(1,4-dimethyl-1H-imidazol-5-yl)-4H-1,2,4-triazol-3-yl)tetrahydro-2H-pyran-4-yl)-N-methylbenzamide

ID: ALA4636686

PubChem CID: 135219005

Max Phase: Preclinical

Molecular Formula: C20H23ClN6O2

Molecular Weight: 414.90

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ncn(C)c1-c1nnc([C@@H]2C[C@H](N(C)C(=O)c3cccc(Cl)c3)CCO2)[nH]1

Standard InChI:  InChI=1S/C20H23ClN6O2/c1-12-17(26(2)11-22-12)19-23-18(24-25-19)16-10-15(7-8-29-16)27(3)20(28)13-5-4-6-14(21)9-13/h4-6,9,11,15-16H,7-8,10H2,1-3H3,(H,23,24,25)/t15-,16+/m1/s1

Standard InChI Key:  BXXHDFMDNCTGJA-CVEARBPZSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   25.7607  -10.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7596  -10.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4676  -11.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1773  -10.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1745  -10.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4659   -9.6739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8806   -9.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5899  -10.0738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8776   -8.8507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5930  -10.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2960   -9.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0078  -10.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7119   -9.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7130   -8.8481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0039   -8.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2937   -8.8495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4196  -10.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5043  -10.8836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3037  -11.0535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7123  -10.3457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1654   -9.7386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5255  -10.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0058  -10.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7783  -10.7449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7754   -9.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0011   -9.6833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7560  -11.7771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9960   -8.8653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4674  -12.1285    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 11  8  1  6
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 13 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  1  0
 23 27  1  0
 26 28  1  0
  3 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4636686

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.90Molecular Weight (Monoisotopic): 414.1571AlogP: 3.16#Rotatable Bonds: 4
Polar Surface Area: 88.93Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.33CX Basic pKa: 5.06CX LogP: 0.95CX LogD: 0.88
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.71Np Likeness Score: -1.03

References

1. Liu LZ, Ma T, Zhou J, Long Hu Z, Jun Zhang X, Zhen Zhang H, Zeng M, Liu J, Li L, Jiang Y, Zou Z, Wang F, Zhang L, Xu J, Wang J, Xiao F, Fang X, Zou H, Efanov AM, Thomas MK, Lin HV, Chen J..  (2020)  Discovery of LY3325656: A GPR142 agonist suitable for clinical testing in human.,  30  (5): [PMID:31982234] [10.1016/j.bmcl.2019.126857]
2.  (2019)  Tetrahydropyranyl benzamide derivatives,