The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Herbimycin K ID: ALA4636793
PubChem CID: 156011856
Max Phase: Preclinical
Molecular Formula: C29H40N2O8
Molecular Weight: 544.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(O)cc2c3c1C[C@@H](C)C[C@H](OC)[C@H](O3)[C@@H](C)/C=C(\C)[C@H](OC(N)=O)[C@@H](OC)/C=C\C=C(\C)C(=O)N2
Standard InChI: InChI=1S/C29H40N2O8/c1-15-11-19-26-20(14-21(32)27(19)37-7)31-28(33)16(2)9-8-10-22(35-5)24(39-29(30)34)17(3)13-18(4)25(38-26)23(12-15)36-6/h8-10,13-15,18,22-25,32H,11-12H2,1-7H3,(H2,30,34)(H,31,33)/b10-8-,16-9-,17-13+/t15-,18+,22+,23+,24+,25-/m1/s1
Standard InChI Key: DACCJZDTYKYKSL-BUDIMTRBSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
19.4648 -13.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4635 -14.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1755 -14.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8888 -14.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8859 -13.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1736 -12.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5966 -14.4624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7606 -14.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7599 -15.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4622 -15.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4615 -16.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1727 -16.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1720 -17.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3075 -14.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8830 -18.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6020 -17.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6031 -16.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7585 -16.9223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6912 -17.8169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4508 -18.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4412 -15.3798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0349 -16.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0343 -15.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1720 -11.9893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7497 -12.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0245 -13.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1048 -18.5462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9361 -18.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3578 -17.8362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3411 -19.2764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3059 -13.1904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1110 -14.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1517 -17.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8880 -16.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1098 -15.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8836 -14.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5275 -13.5773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8872 -16.5109 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.5776 -16.4962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8037 -15.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
2 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
7 14 1 0
13 15 1 0
15 16 2 0
16 17 1 0
11 18 1 1
16 19 1 0
13 20 1 6
3 21 1 0
12 21 1 0
18 22 1 0
9 23 1 6
6 24 1 0
1 25 1 0
25 26 1 0
19 27 1 1
27 28 1 0
28 29 2 0
28 30 1 0
14 31 2 0
14 32 1 0
19 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 32 2 0
32 37 1 0
12 38 1 1
33 39 1 1
39 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.65Molecular Weight (Monoisotopic): 544.2785AlogP: 4.26#Rotatable Bonds: 4Polar Surface Area: 138.57Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.21CX Basic pKa: ┄CX LogP: 4.10CX LogD: 4.10Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.48Np Likeness Score: 2.36
References 1. Nong XH, Tu ZC, Qi SH.. (2020) Ansamycin derivatives from the marine-derived Streptomyces sp. SCSGAA 0027 and their cytotoxic and antiviral activities., 30 (11): [PMID:32273216 ] [10.1016/j.bmcl.2020.127168 ]