The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-benzyl-2-(3-phenyl-2-[(5-(pyrrolidin-1-yl)pentyl)]thio-3,4-dihydroquinazolin-4-yl)acetamide ID: ALA4636912
PubChem CID: 156011773
Max Phase: Preclinical
Molecular Formula: C32H38N4OS
Molecular Weight: 526.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CC1c2ccccc2N=C(SCCCCCN2CCCC2)N1c1ccccc1)NCc1ccccc1
Standard InChI: InChI=1S/C32H38N4OS/c37-31(33-25-26-14-4-1-5-15-26)24-30-28-18-8-9-19-29(28)34-32(36(30)27-16-6-2-7-17-27)38-23-13-3-10-20-35-21-11-12-22-35/h1-2,4-9,14-19,30H,3,10-13,20-25H2,(H,33,37)
Standard InChI Key: CEBOAMBQCPCJSE-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
16.9491 -5.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9480 -6.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6560 -6.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6542 -4.9317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3628 -5.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3617 -6.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0679 -6.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7798 -6.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7809 -5.3390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0702 -4.9254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0702 -4.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3625 -3.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3625 -2.8824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6548 -4.1082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9471 -3.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2394 -4.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5329 -3.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8256 -4.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8252 -4.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5378 -5.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2422 -4.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4863 -6.5702 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.1952 -6.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9017 -6.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6106 -6.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3171 -6.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0260 -6.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7326 -6.5821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4896 -4.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1948 -5.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9030 -4.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9054 -4.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1937 -3.7127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4884 -4.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8190 -7.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6179 -7.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0285 -6.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4833 -6.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
9 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
28 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.75Molecular Weight (Monoisotopic): 526.2766AlogP: 6.94#Rotatable Bonds: 11Polar Surface Area: 47.94Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.57CX LogP: 6.83CX LogD: 4.68Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.03
References 1. Nam Y, Ryu KD, Jang C, Moon YH, Kim M, Ko D, Chung KS, Gandini MA, Lee KT, Zamponi GW, Lee JY.. (2020) Synthesis and cytotoxic effects of 2-thio-3,4-dihydroquinazoline derivatives as novel T-type calcium channel blockers., 28 (11): [PMID:32327350 ] [10.1016/j.bmc.2020.115491 ]