The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Amphiepicoccin F ID: ALA4636917
PubChem CID: 156011776
Max Phase: Preclinical
Molecular Formula: C20H24N2O7S2
Molecular Weight: 468.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@H]1CC(=O)[C@@H]2C[C@@]3(SC)C(=O)N4[C@@H]5[C@@H](O)[C@H]6CC(=O)[C@@H]5C[C@@]4(S6)C(=O)N3[C@@H]2[C@H]1O
Standard InChI: InChI=1S/C20H24N2O7S2/c1-29-11-3-9(23)7-5-19(30-2)17(27)22-14-8-6-20(22,18(28)21(19)13(7)15(11)25)31-12(16(14)26)4-10(8)24/h7-8,11-16,25-26H,3-6H2,1-2H3/t7-,8-,11-,12+,13-,14-,15-,16-,19+,20+/m0/s1
Standard InChI Key: JGBGTRQOJHIYLP-YXKLBDOSSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
38.2961 -6.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9807 -6.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9807 -5.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2961 -4.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6114 -6.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6111 -5.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8604 -6.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3888 -5.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8519 -5.0880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5282 -4.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6062 -5.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2857 -4.9305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7402 -4.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2752 -3.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5338 -4.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5286 -3.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8482 -3.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1724 -3.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1814 -4.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8625 -5.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1459 -6.2968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9940 -3.7290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4162 -5.7740 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.6114 -6.9090 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
37.6032 -4.5317 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.2961 -7.3011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2972 -4.1314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6627 -4.9238 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
33.8419 -2.7212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8713 -5.8911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5284 -5.4933 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
34.5243 -3.1078 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36.1339 -3.5907 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.7261 -2.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4949 -5.1171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7950 -4.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 1 0
6 9 1 0
8 7 1 0
7 5 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 1 0
13 14 1 0
14 16 1 0
15 12 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 15 1 0
11 21 2 0
10 22 2 0
3 23 1 0
5 24 1 1
6 25 1 1
1 26 2 0
4 27 1 1
3 28 1 6
17 29 2 0
20 30 1 1
15 31 1 1
16 32 1 1
13 33 1 6
33 34 1 0
19 35 1 1
35 36 1 0
8 23 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.55Molecular Weight (Monoisotopic): 468.1025AlogP: -1.01#Rotatable Bonds: 2Polar Surface Area: 124.45Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.40CX Basic pKa: ┄CX LogP: -0.43CX LogD: -0.43Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: 2.38
References 1. Wang Q, Zhang K, Wang W, Zhang G, Zhu T, Che Q, Gu Q, Li D.. (2020) Amphiepicoccins A-J: Epipolythiodioxopiperazines from the Fish-Gill-Derived Fungus Epicoccum nigrum HDN17-88., 83 (2): [PMID:31975590 ] [10.1021/acs.jnatprod.9b01242 ]