2-(3-(4-((4-(1H-Pyrazol-4-yl)phenyl)amino)-6-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)phenoxy)-N-isobutylacetamide

ID: ALA4637272

PubChem CID: 124159094

Max Phase: Preclinical

Molecular Formula: C29H33N7O2

Molecular Weight: 511.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)CNC(=O)COc1cccc(-c2nc3c(c(Nc4ccc(-c5cn[nH]c5)cc4)n2)CN(C)CC3)c1

Standard InChI:  InChI=1S/C29H33N7O2/c1-19(2)14-30-27(37)18-38-24-6-4-5-21(13-24)28-34-26-11-12-36(3)17-25(26)29(35-28)33-23-9-7-20(8-10-23)22-15-31-32-16-22/h4-10,13,15-16,19H,11-12,14,17-18H2,1-3H3,(H,30,37)(H,31,32)(H,33,34,35)

Standard InChI Key:  ZBUBQAUYMPLXJE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   30.3349  -27.8491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0486  -27.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0458  -26.6087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3331  -26.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3306  -25.3822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0412  -24.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7481  -25.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4582  -24.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4562  -24.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7382  -23.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0351  -24.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1607  -23.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9128  -24.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4611  -23.4493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0453  -22.7392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2427  -22.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7535  -27.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7534  -28.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4651  -29.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1772  -28.6665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1733  -27.8409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4611  -27.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8831  -27.4246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5970  -27.8337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3067  -27.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3026  -26.5961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.0206  -27.8265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7304  -27.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6227  -27.4360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6268  -26.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9233  -26.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2113  -26.6098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2072  -27.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9151  -27.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5062  -26.1967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4409  -27.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1458  -27.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4465  -28.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 29  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 30  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 12  2  0
  9 12  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  2 17  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 29 30  2  0
 29 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 28 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4637272

    ---

Associated Targets(Human)

SLC2A3 Tchem Solute carrier family 2, facilitated glucose transporter member 3 (465 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.63Molecular Weight (Monoisotopic): 511.2696AlogP: 4.42#Rotatable Bonds: 9
Polar Surface Area: 108.06Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.84CX Basic pKa: 6.94CX LogP: 4.32CX LogD: 4.19
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.54

References

1. Liu KG, Kim JI, Olszewski K, Barsotti AM, Morris K, Lamarque C, Yu X, Gaffney J, Feng XJ, Patel JP, Poyurovsky MV..  (2020)  Discovery and Optimization of Glucose Uptake Inhibitors.,  63  (10): [PMID:32282207] [10.1021/acs.jmedchem.9b02153]

Source