1-isobutyl-5-(2,4-difluorophenyl)biguanide

ID: ALA4637684

PubChem CID: 156012693

Max Phase: Preclinical

Molecular Formula: C12H17F2N5

Molecular Weight: 269.30

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)CNC(=N)NC(=N)Nc1ccc(F)cc1F

Standard InChI:  InChI=1S/C12H17F2N5/c1-7(2)6-17-11(15)19-12(16)18-10-4-3-8(13)5-9(10)14/h3-5,7H,6H2,1-2H3,(H5,15,16,17,18,19)

Standard InChI Key:  PCTSKRZHGMDRHI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 19  0  0  0  0  0  0  0  0999 V2000
    2.1571  -18.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1560  -19.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8640  -19.5822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5737  -19.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5709  -18.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8622  -17.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2820  -19.5803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9891  -19.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6974  -19.5781    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4045  -19.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1129  -19.5759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8199  -19.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5283  -19.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9878  -18.3534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4032  -18.3512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4493  -17.9453    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.5296  -20.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2353  -19.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8638  -20.3994    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  8 14  2  0
 10 15  2  0
  1 16  1  0
 13 17  1  0
 13 18  1  0
  3 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4637684

    ---

Associated Targets(Human)

UMUC3 (278 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
T-24 (2342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A2780 (11979 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 269.30Molecular Weight (Monoisotopic): 269.1452AlogP: 2.08#Rotatable Bonds: 3
Polar Surface Area: 83.79Molecular Species: BASEHBA: 2HBD: 5
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.15CX LogP: 2.53CX LogD: 0.05
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.43Np Likeness Score: -0.97

References

1. Xiao D, Lu Z, Wang Z, Zhou S, Cao M, Deng J, Hu X, Peng M, He C, Wu J, Xu S, Zhang H, Xu C, Wang W, Guan A, Yang X..  (2020)  Synthesis, biological evaluation and anti-proliferative mechanism of fluorine-containing proguanil derivatives.,  28  (2): [PMID:31864776] [10.1016/j.bmc.2019.115258]

Source