The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Albanol B ID: ALA4637788
PubChem CID: 10415366
Max Phase: Preclinical
Molecular Formula: C34H22O8
Molecular Weight: 558.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc2c3c(c1)-c1c(O)cc(-c4cc5ccc(O)cc5o4)cc1O[C@@]3(c1ccc(O)cc1O)Oc1cc(O)ccc1-2
Standard InChI: InChI=1S/C34H22O8/c1-16-8-23-22-6-4-21(37)15-30(22)41-34(25-7-5-19(35)13-26(25)38)33(23)24(9-16)32-27(39)10-18(12-31(32)42-34)28-11-17-2-3-20(36)14-29(17)40-28/h2-15,35-39H,1H3/t34-/m1/s1
Standard InChI Key: SMHBZVSVLIBGGO-UUWRZZSWSA-N
Molfile:
RDKit 2D
42 49 0 0 0 0 0 0 0 0999 V2000
8.2895 -16.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9972 -15.6863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7049 -16.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7049 -16.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9972 -17.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2895 -16.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5803 -17.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8722 -16.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8696 -16.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5773 -15.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1615 -15.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4149 -16.0210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8633 -15.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2748 -14.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0764 -14.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8646 -13.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0465 -13.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6402 -14.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0480 -15.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8207 -14.7034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5803 -18.1374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9972 -18.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7049 -18.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4127 -18.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4127 -17.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1246 -16.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1246 -16.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4127 -15.6863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8297 -15.6847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5378 -16.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5404 -16.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8369 -17.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2500 -15.6843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7049 -19.3664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7049 -15.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9970 -14.8663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9981 -14.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7064 -13.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4106 -14.0454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4174 -14.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1254 -15.2718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7064 -12.8231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 2 0
6 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
1 10 1 0
11 9 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
13 19 1 0
18 20 1 0
7 21 1 0
5 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
3 28 1 0
27 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
26 32 1 0
30 33 1 0
4 25 1 0
23 34 1 0
3 35 1 6
36 35 2 0
37 36 1 0
38 37 2 0
39 38 1 0
40 39 2 0
35 40 1 0
40 41 1 0
38 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.54Molecular Weight (Monoisotopic): 558.1315AlogP: 7.26#Rotatable Bonds: 2Polar Surface Area: 132.75Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.30CX Basic pKa: ┄CX LogP: 7.54CX LogD: 7.49Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: 1.23
References 1. Heger V, Benesova B, Viskupicova J, Majekova M, Zoofishan Z, Hunyadi A, Horakova L.. (2020) Phenolic Compounds from Morus nigra Regulate Viability and Apoptosis of Pancreatic β-Cells Possibly via SERCA Activity., 11 (5): [PMID:32435418 ] [10.1021/acsmedchemlett.0c00047 ]