The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Choerosponol D ID: ALA4637887
PubChem CID: 156011180
Max Phase: Preclinical
Molecular Formula: C25H44O4
Molecular Weight: 408.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCC/C=C\CCCCCCCCCCC[C@H](O)C[C@]1(O)CC(=O)C=C[C@H]1O
Standard InChI: InChI=1S/C25H44O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)20-25(29)21-23(27)18-19-24(25)28/h5-6,18-19,22,24,26,28-29H,2-4,7-17,20-21H2,1H3/b6-5-/t22-,24+,25-/m0/s1
Standard InChI Key: CBOSKKOKKUAPTJ-CDZZXVROSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
17.5655 -11.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2754 -12.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9836 -11.9616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6949 -12.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4072 -11.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1186 -12.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8309 -11.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5423 -12.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2546 -11.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9618 -12.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6741 -11.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3855 -12.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0978 -11.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8091 -12.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8082 -13.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0958 -13.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3845 -13.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6722 -13.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5665 -11.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8532 -12.3685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8551 -10.7258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8584 -9.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1478 -9.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4345 -9.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4362 -10.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1473 -11.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1502 -11.9618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1492 -8.6760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5572 -10.3098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
1 19 1 0
1 20 1 6
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 21 1 0
26 27 1 6
23 28 2 0
21 29 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.62Molecular Weight (Monoisotopic): 408.3240AlogP: 5.40#Rotatable Bonds: 17Polar Surface Area: 77.76Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.21CX Basic pKa: ┄CX LogP: 5.88CX LogD: 5.88Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.22Np Likeness Score: 1.89
References 1. Kil YS, Risinger AL, Petersen CL, Liang H, Grkovic T, O'Keefe BR, Mooberry SL, Cichewicz RH.. (2020) Using the Cancer Dependency Map to Identify the Mechanism of Action of a Cytotoxic Alkenyl Derivative from the Fruit of Choerospondias axillaris ., 83 (3): [PMID:32105068 ] [10.1021/acs.jnatprod.9b00896 ]