The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(6,8-di-tert-butyl-2-oxo-2H-chromen-3-yl)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA4638940
PubChem CID: 156013390
Max Phase: Preclinical
Molecular Formula: C29H30FNO5
Molecular Weight: 491.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)O)c(=O)c2cc(F)c(-c3cc4cc(C(C)(C)C)cc(C(C)(C)C)c4oc3=O)cc21
Standard InChI: InChI=1S/C29H30FNO5/c1-8-31-14-20(26(33)34)24(32)19-12-22(30)17(13-23(19)31)18-10-15-9-16(28(2,3)4)11-21(29(5,6)7)25(15)36-27(18)35/h9-14H,8H2,1-7H3,(H,33,34)
Standard InChI Key: JRGMZYRNPNRTEG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
21.1465 -23.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1454 -24.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8534 -25.2035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8516 -23.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5602 -23.9714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5590 -24.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2691 -25.2080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9850 -24.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9862 -23.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2715 -23.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2716 -22.7404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6949 -23.5666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6969 -22.7494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4387 -23.5666 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.2668 -26.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4016 -23.9769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9734 -26.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4409 -25.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7336 -24.7890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7301 -26.4224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4422 -26.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0229 -26.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0314 -25.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3313 -24.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6220 -25.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6174 -26.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3182 -26.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1491 -26.4261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9174 -24.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3131 -27.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9236 -23.9528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2067 -25.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2035 -24.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6029 -27.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0183 -27.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3084 -28.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
9 12 1 0
12 13 2 0
1 14 1 0
7 15 1 0
12 16 1 0
15 17 1 0
18 19 2 0
18 21 1 0
19 23 1 0
22 20 1 0
20 21 1 0
2 18 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
25 29 1 0
27 30 1 0
29 31 1 0
29 32 1 0
29 33 1 0
30 34 1 0
30 35 1 0
30 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.56Molecular Weight (Monoisotopic): 491.2108AlogP: 6.23#Rotatable Bonds: 3Polar Surface Area: 89.51Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.56CX Basic pKa: ┄CX LogP: 6.44CX LogD: 4.60Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -0.46
References 1. Suaifan GARY, Mohammed AAM.. (2019) Fluoroquinolones structural and medicinal developments (2013-2018): Where are we now?, 27 (14): [PMID:31182257 ] [10.1016/j.bmc.2019.05.038 ]