Pentyl (((((R)-1-((4-amino-5-fluoropyrimidin-2-yl)oxy)propan-2-yl)oxy)methyl)(phenoxy)phosphoryl)-L-valinate

ID: ALA4639275

PubChem CID: 156013421

Max Phase: Preclinical

Molecular Formula: C24H36FN4O6P

Molecular Weight: 526.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCOC(=O)[C@@H](NP(=O)(CO[C@H](C)COc1ncc(F)c(N)n1)Oc1ccccc1)C(C)C

Standard InChI:  InChI=1S/C24H36FN4O6P/c1-5-6-10-13-32-23(30)21(17(2)3)29-36(31,35-19-11-8-7-9-12-19)16-34-18(4)15-33-24-27-14-20(25)22(26)28-24/h7-9,11-12,14,17-18,21H,5-6,10,13,15-16H2,1-4H3,(H,29,31)(H2,26,27,28)/t18-,21+,36?/m1/s1

Standard InChI Key:  PJIZTVUNWQKFLB-VDHVKOHVSA-N

Molfile:  

 
     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
    3.8235  -12.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8223  -13.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5372  -13.9983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2536  -13.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2507  -12.7545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5354  -12.3454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5329  -11.5204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9687  -13.9964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9700  -14.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6851  -15.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6864  -16.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3989  -14.8192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1140  -15.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8279  -14.8169    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    9.5430  -15.2283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8265  -13.9919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8207  -15.6415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2568  -14.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9719  -15.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6857  -14.8124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9731  -16.0510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1115  -13.5806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1120  -12.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3977  -12.3447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6829  -12.7584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6869  -13.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4017  -13.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4008  -15.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1146  -14.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8297  -15.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5436  -14.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2554  -13.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9693  -13.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5404  -13.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1090  -12.3458    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.2586  -15.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  6
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  2  0
 15 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 16 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 20 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 18 32  1  1
 32 33  1  0
 32 34  1  0
  1 35  1  0
 31 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4639275

    ---

Associated Targets(Human)

HEL (6614 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cytomegalovirus (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human alphaherpesvirus 3 (4092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.55Molecular Weight (Monoisotopic): 526.2356AlogP: 4.56#Rotatable Bonds: 16
Polar Surface Area: 134.89Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.34CX Basic pKa: 3.27CX LogP: 4.40CX LogD: 4.40
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.18Np Likeness Score: -0.43

References

1. Luo M, Groaz E, Snoeck R, Andrei G, Herdewijn P..  (2020)  Amidate Prodrugs of O-2-Alkylated Pyrimidine Acyclic Nucleosides Display Potent Anti-Herpesvirus Activity.,  11  (7): [PMID:32676147] [10.1021/acsmedchemlett.0c00090]

Source