The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tiancimycin C ID: ALA4639420
PubChem CID: 137349161
Max Phase: Preclinical
Molecular Formula: C29H21NO11
Molecular Weight: 559.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](O)[C@@](C)(O)[C@@]12O[C@]13c1cc(O)c4c(c1N[C@H]2C#C/C=C\C#C[C@H]3O)C(=O)c1c(ccc(O)c1O)C4=O
Standard InChI: InChI=1S/C29H21NO11/c1-27(39,25(37)26(38)40-2)29-16-7-5-3-4-6-8-17(33)28(29,41-29)13-11-15(32)19-20(21(13)30-16)24(36)18-12(22(19)34)9-10-14(31)23(18)35/h3-4,9-11,16-17,25,30-33,35,37,39H,1-2H3/b4-3-/t16-,17+,25-,27+,28-,29+/m0/s1
Standard InChI Key: KPDKPRCLDGTNFK-UUNAQHPASA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
22.5126 -4.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5115 -5.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2195 -5.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2177 -4.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9263 -4.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9297 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6421 -5.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6353 -4.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3523 -4.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3551 -5.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0698 -5.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7820 -5.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0600 -4.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7775 -4.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7652 -2.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0507 -3.1850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2153 -3.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8048 -4.0242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6308 -3.1940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6446 -6.4788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4827 -3.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5056 -3.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7692 -3.5783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7608 -1.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7527 -1.1309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7445 -0.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2284 -4.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4973 -0.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5982 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7494 -2.2415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1928 -2.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8981 -3.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6081 -2.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3135 -3.1924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0235 -2.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6128 -1.9626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8935 -4.0016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1974 -1.9546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8947 -2.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7253 -5.0151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0735 -6.4734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28 29 1 0
29 30 3 0
30 27 1 0
1 2 2 0
21 31 1 0
31 32 1 0
2 3 1 0
32 33 1 0
3 6 2 0
33 34 1 0
34 35 1 0
5 4 2 0
33 36 2 0
4 1 1 0
32 37 1 6
5 6 1 0
31 38 1 6
31 39 1 0
27 40 1 1
11 41 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 14 1 0
13 9 1 0
13 14 2 0
13 16 1 0
14 22 1 0
21 15 1 0
15 16 1 0
4 17 1 0
1 18 1 0
8 19 2 0
7 20 2 0
22 21 1 0
21 23 1 6
22 23 1 6
15 24 1 1
24 25 3 0
25 26 1 0
22 27 1 0
26 28 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.48Molecular Weight (Monoisotopic): 559.1115AlogP: -0.44#Rotatable Bonds: 3Polar Surface Area: 206.38Molecular Species: NEUTRALHBA: 12HBD: 7#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.44CX Basic pKa: ┄CX LogP: 2.46CX LogD: 2.17Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.07Np Likeness Score: 1.94
References 1. Adhikari A, Teijaro CN, Yan X, Chang CY, Gui C, Liu YC, Crnovcic I, Yang D, Annaval T, Rader C, Shen B.. (2020) Characterization of TnmH as an O -Methyltransferase Revealing Insights into Tiancimycin Biosynthesis and Enabling a Biocatalytic Strategy To Prepare Antibody-Tiancimycin Conjugates., 63 (15): [PMID:32658465 ] [10.1021/acs.jmedchem.0c00799 ]