lyoniol-A

ID: ALA463954

PubChem CID: 44584061

Max Phase: Preclinical

Molecular Formula: C22H34O7

Molecular Weight: 410.51

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Synonyms: Lyoniol A | Lyoniol A|Lyoniatoxin|CHEMBL463954

Canonical SMILES:  CC(=O)O[C@@H]1[C@@H](O)[C@@]23C[C@@H](CC[C@H]2[C@@](C)(O)[C@@H]2[C@@H]4O[C@@H]4C(C)(C)[C@@]12O)[C@](C)(O)C3

Standard InChI:  InChI=1S/C22H34O7/c1-10(23)28-17-15(24)21-8-11(19(4,25)9-21)6-7-12(21)20(5,26)14-13-16(29-13)18(2,3)22(14,17)27/h11-17,24-27H,6-9H2,1-5H3/t11-,12+,13+,14+,15-,16+,17-,19-,20-,21-,22+/m1/s1

Standard InChI Key:  ASDPUXKPNOGLSZ-CRRNJOFASA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -1.8494   -5.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2759   -7.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4491   -7.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7860   -6.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5918   -5.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6134   -6.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1065   -5.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9288   -6.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1526   -6.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4544   -6.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2811   -5.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5014   -5.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7170   -7.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6663   -7.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4603   -6.8515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4436   -4.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4110   -6.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6195   -7.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5962   -4.9221    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1065   -4.9480    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1711   -5.8576    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9295   -5.8477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2933   -5.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0732   -5.0305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4561   -8.0477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6483   -7.9596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1814   -8.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5496   -9.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3422   -8.6020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5151   -6.4333    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2933   -4.4897    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6607   -7.8962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2680   -4.6847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2028   -7.2616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  3  1  0
  2  3  1  0
  4  5  1  0
  5 23  1  0
 22  6  1  0
  6  4  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 13  1  1
 10 14  1  0
 13 14  1  0
 14 15  1  1
  1 16  1  1
  6 17  1  0
  6 18  1  0
  5 19  1  6
  7 20  1  1
 10 21  1  6
 23 22  1  0
 23 24  1  0
 22 24  1  0
  3 25  1  6
  2 26  1  1
 26 27  1  0
 27 28  1  0
 27 29  2  0
 22 30  1  6
 23 31  1  6
  5  1  1  0
  1  7  1  0
  4  2  1  0
 14 32  1  0
  1 33  1  0
  4 34  1  1
M  END

Alternative Forms

  1. Parent:

    ALA463954

    LYONIOL A

Associated Targets(non-human)

Lymantria dispar (12 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.51Molecular Weight (Monoisotopic): 410.2305AlogP: 0.76#Rotatable Bonds: 1
Polar Surface Area: 119.75Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.86CX Basic pKa: CX LogP: -0.16CX LogD: -0.16
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.37Np Likeness Score: 3.44

References

1. El-Naggar SF, Doskotch RW, ODell TM, Girard L.  (1980)  Antifeedant Diterpenes For the Gypsy Moth Larvae From Kalmia latifolia: Isolation and Characterization of Ten Grayanoids,  43  (5): [10.1021/np50011a016]

Source