The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]-3-oxo-propyl]-triphenyl-phosphonium Bromide ID: ALA4639618
PubChem CID: 156013375
Max Phase: Preclinical
Molecular Formula: C28H26BBrNO3P
Molecular Weight: 466.31
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)Nc1ccc2c(c1)B(O)OC2.[Br-]
Standard InChI: InChI=1S/C28H25BNO3P.BrH/c31-28(30-23-17-16-22-21-33-29(32)27(22)20-23)18-19-34(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26;/h1-17,20,32H,18-19,21H2;1H
Standard InChI Key: LZMRQSDNIPAVDN-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
18.5519 -7.5157 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
16.1003 -4.6638 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
19.6401 -5.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6389 -5.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3470 -6.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3452 -4.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0538 -5.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0541 -5.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8327 -6.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3137 -5.4776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8323 -4.8156 0.0000 B 0 0 0 0 0 0 0 0 0 0 0 0
18.9323 -4.6639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2246 -5.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5168 -4.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2248 -5.8899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8092 -5.0730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0845 -4.0383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1012 -3.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8109 -3.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8110 -2.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1027 -2.2160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3927 -2.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3961 -3.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0962 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3841 -5.8841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3797 -6.7005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0858 -7.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7980 -6.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7989 -5.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2831 -4.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8800 -3.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0635 -3.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6505 -4.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0599 -5.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8750 -5.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
4 5 1 0
5 8 2 0
7 6 2 0
6 3 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
3 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 2 1 0
11 17 1 0
2 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
2 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M CHG 2 1 -1 2 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.31Molecular Weight (Monoisotopic): 466.1738AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Jonnalagadda SK, Wielenberg K, Ronayne CT, Jonnalagadda S, Kiprof P, Jonnalagadda SC, Mereddy VR.. (2020) Synthesis and biological evaluation of arylphosphonium-benzoxaborole conjugates as novel anticancer agents., 30 (14): [PMID:32527557 ] [10.1016/j.bmcl.2020.127259 ]