Pentyl (((((R)-1-((4-amino-5-fluoropyrimidin-2-yl)oxy)-3-fluoropropan-2-yl)oxy)methyl)(phenoxy)phosphoryl)-L-valinate

ID: ALA4639857

PubChem CID: 156015813

Max Phase: Preclinical

Molecular Formula: C24H35F2N4O6P

Molecular Weight: 544.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCOC(=O)[C@@H](NP(=O)(CO[C@@H](CF)COc1ncc(F)c(N)n1)Oc1ccccc1)C(C)C

Standard InChI:  InChI=1S/C24H35F2N4O6P/c1-4-5-9-12-33-23(31)21(17(2)3)30-37(32,36-18-10-7-6-8-11-18)16-35-19(13-25)15-34-24-28-14-20(26)22(27)29-24/h6-8,10-11,14,17,19,21H,4-5,9,12-13,15-16H2,1-3H3,(H,30,32)(H2,27,28,29)/t19-,21-,37?/m0/s1

Standard InChI Key:  OOVUZLZGHMTXMD-OEXKZTTJSA-N

Molfile:  

 
     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
    2.8277   -3.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8265   -4.1606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5414   -4.5734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2577   -4.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2549   -3.3296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5396   -2.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5370   -2.0955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9729   -4.5715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9742   -5.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6893   -5.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6906   -6.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9767   -7.0465    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4031   -5.3943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1182   -5.8056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8320   -5.3920    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    8.5471   -5.8034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8307   -4.5671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8249   -6.2166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2609   -5.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9761   -5.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6899   -5.3875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9773   -6.6261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1157   -4.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1162   -3.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4019   -2.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6871   -3.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6911   -4.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4059   -4.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4050   -5.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1188   -5.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8339   -5.7967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5478   -5.3831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2628   -5.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2596   -4.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9735   -4.1511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5446   -4.1534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1132   -2.9209    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  1
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  2  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 17 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 21 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 19 34  1  1
 34 35  1  0
 34 36  1  0
  1 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4639857

    ---

Associated Targets(Human)

HEL (6614 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cytomegalovirus (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human alphaherpesvirus 3 (4092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.54Molecular Weight (Monoisotopic): 544.2262AlogP: 4.51#Rotatable Bonds: 17
Polar Surface Area: 134.89Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.34CX Basic pKa: 3.27CX LogP: 4.24CX LogD: 4.24
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.17Np Likeness Score: -0.36

References

1. Luo M, Groaz E, Snoeck R, Andrei G, Herdewijn P..  (2020)  Amidate Prodrugs of O-2-Alkylated Pyrimidine Acyclic Nucleosides Display Potent Anti-Herpesvirus Activity.,  11  (7): [PMID:32676147] [10.1021/acsmedchemlett.0c00090]

Source