The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-4'-(1-((4-(hydroxycarbamoyl)phenyl)carbamoyl)cyclopentyl)-[1,1'-biphenyl]-3-carboxylic acid ID: ALA4640415
PubChem CID: 156015592
Max Phase: Preclinical
Molecular Formula: C26H24N2O5
Molecular Weight: 444.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cccc(-c2ccc(C3(C(=O)Nc4ccc(C(=O)NO)cc4)CCCC3)cc2)c1
Standard InChI: InChI=1S/C26H24N2O5/c29-23(28-33)18-8-12-22(13-9-18)27-25(32)26(14-1-2-15-26)21-10-6-17(7-11-21)19-4-3-5-20(16-19)24(30)31/h3-13,16,33H,1-2,14-15H2,(H,27,32)(H,28,29)(H,30,31)
Standard InChI Key: LXUDZYCOGQLEHS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
6.3375 -30.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1625 -30.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4192 -29.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7500 -28.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0849 -29.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6069 -27.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6058 -28.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3206 -28.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0370 -28.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0341 -27.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3187 -27.2955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4660 -28.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1810 -28.9443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8949 -28.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6086 -28.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3220 -28.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3212 -27.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6011 -27.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8906 -27.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0344 -27.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7501 -27.7004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4633 -27.2858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4646 -27.7079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0320 -26.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8945 -27.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8956 -26.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1818 -26.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4664 -26.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4694 -27.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1836 -27.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7564 -27.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0404 -27.3051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7596 -28.5399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
9 4 1 0
4 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
12 23 2 0
20 24 2 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
6 25 1 0
29 31 1 0
31 32 1 0
31 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.49Molecular Weight (Monoisotopic): 444.1685AlogP: 4.62#Rotatable Bonds: 6Polar Surface Area: 115.73Molecular Species: ACIDHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.00CX Basic pKa: ┄CX LogP: 4.72CX LogD: 1.56Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -0.82
References 1. Tng J, Lim J, Wu KC, Lucke AJ, Xu W, Reid RC, Fairlie DP.. (2020) Achiral Derivatives of Hydroxamate AR-42 Potently Inhibit Class I HDAC Enzymes and Cancer Cell Proliferation., 63 (11): [PMID:32383881 ] [10.1021/acs.jmedchem.0c00230 ]