The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dipentyl (((((S)-1-((4-aminopyrimidin-2-yl)oxy)-3-fluoropropan-2-yl)oxy)methyl)(phenoxy)phosphoryl)-L-aspartate ID: ALA4640654
PubChem CID: 134382929
Max Phase: Preclinical
Molecular Formula: C28H42FN4O8P
Molecular Weight: 612.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCOC(=O)C[C@H](NP(=O)(CO[C@H](CF)COc1nccc(N)n1)Oc1ccccc1)C(=O)OCCCCC
Standard InChI: InChI=1S/C28H42FN4O8P/c1-3-5-10-16-37-26(34)18-24(27(35)38-17-11-6-4-2)33-42(36,41-22-12-8-7-9-13-22)21-40-23(19-29)20-39-28-31-15-14-25(30)32-28/h7-9,12-15,23-24H,3-6,10-11,16-21H2,1-2H3,(H,33,36)(H2,30,31,32)/t23-,24+,42?/m1/s1
Standard InChI Key: RTMGITYLXQOQLS-PDIAVZSESA-N
Molfile:
RDKit 2D
42 43 0 0 0 0 0 0 0 0999 V2000
20.3900 -3.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3888 -4.5148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1036 -4.9277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8201 -4.5143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8172 -3.6838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1019 -3.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0994 -2.4497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5352 -4.9257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5364 -5.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2516 -6.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2529 -6.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5391 -7.4007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.9654 -5.7484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6805 -6.1598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3944 -5.7462 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
26.1094 -6.1575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3930 -4.9212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3872 -6.5707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8233 -5.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5383 -6.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2522 -5.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5396 -6.9803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6779 -4.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6785 -3.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9641 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2494 -3.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2533 -4.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9682 -4.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9672 -6.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6811 -5.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3962 -6.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1100 -5.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8252 -6.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8220 -4.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5358 -4.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5345 -3.6803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2509 -4.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9647 -4.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6798 -4.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3936 -4.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1087 -4.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8225 -4.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
10 13 1 6
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
15 18 2 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
17 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
21 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
19 34 1 1
34 35 1 0
35 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 612.64Molecular Weight (Monoisotopic): 612.2724AlogP: 4.84#Rotatable Bonds: 22Polar Surface Area: 161.19Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.34CX Basic pKa: 5.84CX LogP: 4.35CX LogD: 4.34Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.11Np Likeness Score: -0.12
References 1. Luo M, Groaz E, Snoeck R, Andrei G, Herdewijn P.. (2020) Amidate Prodrugs of O -2-Alkylated Pyrimidine Acyclic Nucleosides Display Potent Anti-Herpesvirus Activity., 11 (7): [PMID:32676147 ] [10.1021/acsmedchemlett.0c00090 ]