The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1,6-dimethyl-5,7-dioxo-pyrimido[5,4-e][1,2,4]triazin-3-yl)benzenesulfonamide ID: ALA4640696
PubChem CID: 156015295
Max Phase: Preclinical
Molecular Formula: C13H12N6O4S
Molecular Weight: 348.34
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1nc(-c2ccc(S(N)(=O)=O)cc2)nc2c(=O)n(C)c(=O)nc1-2
Standard InChI: InChI=1S/C13H12N6O4S/c1-18-12(20)9-11(16-13(18)21)19(2)17-10(15-9)7-3-5-8(6-4-7)24(14,22)23/h3-6H,1-2H3,(H2,14,22,23)
Standard InChI Key: VAXPHJVZYNJVMW-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 26 0 0 0 0 0 0 0 0999 V2000
9.9549 -10.5038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3676 -11.2137 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.7760 -10.5013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6844 -12.8357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6844 -13.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3938 -14.0615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3938 -12.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0991 -12.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0956 -13.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8018 -14.0663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5160 -13.6630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5194 -12.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8087 -12.4237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3938 -11.5975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9732 -14.0666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7972 -14.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9714 -12.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2316 -12.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9416 -12.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6550 -12.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6598 -11.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9451 -11.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2345 -11.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0752 -11.6242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 7 1 0
5 6 1 0
6 9 2 0
8 7 1 0
8 9 1 0
8 13 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
7 14 2 0
5 15 2 0
10 16 1 0
4 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
12 18 1 0
21 2 1 0
2 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 348.34Molecular Weight (Monoisotopic): 348.0641AlogP: -1.31#Rotatable Bonds: 2Polar Surface Area: 142.83Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.94CX Basic pKa: ┄CX LogP: -0.61CX LogD: -0.61Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.61Np Likeness Score: -1.39
References 1. Letfus V, Jelić D, Bokulić A, Petrinić Grba A, Koštrun S.. (2020) Rational design, synthesis and biological profiling of new KDM4C inhibitors., 28 (1): [PMID:31784197 ] [10.1016/j.bmc.2019.115128 ]